CAS Market Research Reports

CAS # Chemical Name
30007-47-7 5-Bromo-5-nitro-1,3-dioxane
30018-16-7 1-(Carbethoxyethyl)-triphenylphosphonium bromide
30030-90-1 3-(Trichloroacetyl)-indole
30034-03-8 Cefamandol
30034-13-0 Penicillin G Sulfoxide P-Methoxybenzyl Ester
30036-17-0 4-Ethoxyindole-3-acetonitrile
30043-49-3 1-(5-Ethylsulfonyl-1,3,4-thiadiazol-2-yl)-1,3-dimethylurea
30044-51-0 (S)-(tert-Butylthio)-L-cysteine
30051-65-1 Potassium diaquaoctachloro-µ-nitridodiruthenate
30053-58-8 Dichlorobis-(triphenylphosphite)-platinum(II)
30058-40-3 2-Fluorobenzenesulfonamide
30071-93-3 3',5'-Bis-(trifluoromethyl)-acetophenone
30077-58-8 2,4-Diamino-5-(3,4-dichlorobenzyl)-pyrimidine
30077-81-7 3-Morpholino-2-(3,4,5-trimethoxybenzyl)-acrylonitrile
30082-41-8 3-{[(4-Chlorophenyl)-thio]-methyl}-benzoic acid
30084-90-3 2-Fluorenecarboxaldehyde
30084-91-4 5-Indanecarboxaldehyde
30086-17-0 4-Fluoro-1H-imidazole
30087-00-4 3-Indoleacetic acid, stable isotopes
30093-99-3 4,4-Dimethyl-2-oxazoline
30095-47-7 2-Bromo-4'-tert-butylacetophenone
30097-06-4 Tidiacic
30100-35-7 2-(4-Methoxyphenyl)-p-benzoquinone
30102-73-9 (Chloro)-dimethyl-(5-hexenyl)-silane
30124-19-7 2,6-Dichloro-N-(4-methoxyphenyl)-aniline
30125-47-4 3,4,5,6-Tetrachloro-N-[2-(4,5,6,7-tetrachloro-2,3-dihydro-1,3-dioxo-1H-inden-2-yl)-8-quinolyl]phthalimide
30131-16-9 4-(4-Phenylbutoxy)-benzoic acid
30141-77-6 Propylene Carbonate
30148-21-1 Ethyl 1-methyl-1H-imidazole-2-carboxylate
30148-26-6 (2-Chlorophenyl)-(1-methyl-1H-imidazol-2-yl)-methanone
30148-50-6 Bis-(trimethylsiloxy)-phosphine
30153-47-0 4-Bromo-3-methyl-2-thiophenecarboxaldehyde
30153-85-6 5-Amino-1-(4-chlorobenzyl)-1H-pyrazole
30162-37-9 N-(3-Pyridyl)-2-thiourea
30165-96-9 3-Chloro-4-morpholino-1,2,5-thiadiazole
30165-97-0 4-Morpholino-1,2,5-thiadiazol-3-ol
30168-23-1 4-(Tricyclo[,6]-8-decylidene)-butanal
30185-25-7 5,7-difluoroindole
30186-18-6 4'-Bromo-2'-hydroxyacetophenone
30189-36-7 N2,N6-Bis-(tert-Butoxycarbonyl)-L-lysine N-hydroxysuccinimide ester
30192-81-5 1-(3-Chlorophenyl)-4-imidazoline-2-thione
30198-01-7 2-Hydroxy-4-methyl-8-methoxyquinoline
30203-11-3 3,3'-[sulphonylbis(4,1-phenyleneoxy)]dianiline
30211-77-9 2-Nitro-5-(thiocyanato)-benzoic acid
30216-51-4 2-Hydrazino-1,3-thiazole
30220-46-3 INGENOL
30223-48-4 Fluacizine
30223-75-7 1,5-Dimethyl-3,3-diphenyl-2-pyrrolidone
30232-11-2 Methylcyclohexanol acetate
30233-64-8 Glyceryl monobehenate
30237-07-1 2-(p-Tolyl)-p-benzoquinone
30237-26-4 Fructose
30246-33-4 7-Amino-3-[(5-methyl-1,3,4-thiadiazol-2-yl)-thiomethyl]-cephalosporanic acid
30267-40-4 1-(2,6-Dichlorophenyl)-5-hydroxy-1,3-dihydro-2H-indol-2-one
30269-04-6 1,8-Diaminopyrene
30270-60-1 MONOCERIN
30273-00-8 4,6-Dichloro-o-toluidine (NH2=1)
30273-11-1 4-sec-Butylaniline
30273-22-4 4-Bromo-2-ethylaniline hydrochloride
30273-41-7 4,6-Dibromo-o-toluidine (NH2=1)
30273-42-8 4-Bromo-6-chloro-o-toluidine (NH2=1)
30273-47-3 4-Bromo-5-chloro-2-methylaniline
30275-80-0 N6-Benzoyladenosine-3',5'-cyclic monophosphoric acid sodium salt
30286-75-0 Oxitropium bromide
30290-53-0 POPS
30291-41-9 Alanine N-carboxyanhydride
30299-08-2 Clinofibrate(CFB)
30310-22-6 2-Bromo-4-methylpentane
30310-41-9 2,4-Dimethyl-6-phenyldihydropyran
30318-99-1 3-Bromo-4-methylthiophene
30319-05-2 3-Bromo-2-methylthiophene
30322-28-2 Hexamethylene diisocyanate/trimethylolpropane copolymer
30345-49-4 Tetrabutylphosphonium Acetate
30346-73-7 Xylenesulfonic acid potassium salt, isomer mixture
30354-91-7 2,4-Diamino-6-(4-methoxyphenyl)-1,3,5-triazine
30356-07-1 (S)-1,2,3,4,5,6,7,8-Octahydro-1-[(4-methoxyphenyl)-methyl]-isoquinoline
30361-29-6 (E,E)-2,4-Undecadienal
30363-03-2 2,4,6-Tris-(4-bromo-phenyl)-[1,3,5]triazine
30364-51-3 N-Myristoylsarcosine sodium salt
30374-01-7 3-Mercaptopropionic acid isooctyl ester
30376-45-5 Adipic acid/1,3-butanediol/1,6-hexanediol copolymer
30379-55-6 Benzyloxyacetic acid
30384-93-1 2-Methylimidazo[1,2-a]nicotinaldehyde
30384-96-4 6-Bromoimidazo[1,2-a]pyridine-3-carboxaldehyde
30385-86-5 Ethyl 3-hydroxy-3-methyl-d3-butyrate-4,4,4-d3
30386-01-7 3-Amino-2,4(1H)-quinazolinedione
30388-44-4 4-Mesyl-N-methyl-2-nitroaniline
30389-18-5 1-Ethynylcyclohexylamine
30389-25-4 (Heneicosafluorodecyl)-ethylene
30392-40-6 Bitolterol
30414-54-1 Butyrylacetic acid methyl ester
30418-38-3 (-)-Tretoquinol
30425-47-9 1-(4-Methoxyphenyl)-pyrrolidin-2-one
30432-16-7 1,4-Dibromo-2,3-bis-(bromomethyl)-2-butene
30433-91-1 2-Thiopheneethylamine
30440-88-1 Acetylpyridine
30445-72-8 Wolframic acid
30448-04-5 4,5,6-Trimethoxyindole
30448-16-9 7-Methyl-1H-indole-3-carboxylic acid
30450-62-5 1,2,3,4-Tetrahydro-7-nitroquinoline
30459-17-7 1-[4-(Trifluoromethyl)-phenyl]-piperazine
30467-02-8 8-Methylhypoxanthine
30470-60-1 Adamantane-d16
30473-39-3 Sodium stearoamphoacetate
30483-75-1 4-(4-Bromophenyl)-morpholine
30484-77-6 Flunarizine hydrochloride
30488-22-3 Manganous nitrate
30490-21-2 5,7-Dinitrooxindole
30493-08-4 N-(Imidazo[1,2-a]pyridin-3-ylmethylidene)-hydroxylamine
30501-29-2 Tetrachloro[2.2]paracyclophane
30504-49-5 Azobenzene-d10
30508-78-2 2,4-Diamino-6-[3-(trifluoromethyl)-phenyl]-1,3,5-triazine
30515-87-1 Zidovudine
30516-87-1 Zidovudine(Anti-AIDS)
30525-45-2 Adipic acid-1,4-butyleneglycol-trimethylolpropane copolymer
30525-89-4 Paraformaldehyde
30529-70-5 2-Chloro-6-methylnicotinic acid
30530-42-8 2,4-Diamino-6-(2-fluorophenyl)-1,3,5-triazine
30544-34-4 2,3-DIBROMOFURAN
30544-47-9 Etofenamate
30544-61-7 Clanobutin
30560-19-1 Acephate
30563-77-0 1-Ethyl-2-methyl-5-(trifluoromethyl)-1H-benzimidazole
30566-92-8 5-{[Bis-(benzyl)-amino]-acetyl}-salicylamide
30571-56-3 1,2,3,5-Tetra-O-acetyl-D-xylopyranose
30574-97-1 (E)-2-Methylcrotononitrile
30578-37-1 Amezinium methyl sulfate
30580-75-7 Tert-butyl isopropylphenyl peroxide
30581-59-0 Vinylpyrrolidone/dimethylaminoethyl methacrylate copolymer
30583-33-6 Trichlorotoluene
30609-20-2 3-Butoxybenzaldehyde
30615-87-3 Methylthiohydantoin-DL-phenylalanine
30616-38-7 4-Amino-2-(2-benzothiazolyl)-phenol
30618-84-9 Mercaptoacetic acid glyceryl ester
30637-95-7 Anthraquinone sulfonate
30651-24-2 5-Nitro-α-picolinic acid
30651-60-6 1-Aminopiperazine
30652-11-0 Deferiprone
30653-83-9 Parsalmide
30657-38-6 Pyroglutamic acid L-lysine salt
30662-91-0 Adipic acid/1,4-butanediol/1,6-hexanediol/4,4'-diphenylmethane diisocyanate copolymer
30664-77-8 N-(1-Oxodecyl)-L-tyrosine
30673-60-0 Propyl caprate (decanoate)
30675-13-9 4,5,6,7-Tetrachloroindane-1,3-dione
30683-23-9 3-Bromo-α-picolinic acid
30683-38-6 4,5,6,7-Tetrafluoro-3-indolecarboxaldehyde
30685-43-9 Metildigoxin
30686-73-8 4-[4'-(2'-Methyl)-thiazolyl]-phenol
30693-53-9 4-Nitroaniline-2-sulfonic acid sodium salt
30698-18-1 (3-(Benzoyloxy)-propyl)-triphenylphosphonium bromide
30701-38-3 Sucrose dimyristate
30707-77-8 2-(4-Aminophenyl)-2,4-dihydro-5-(1-pyrrolidinyl)-3H-pyrazol-3-one
30709-67-2 2-Amino-5-methyl-4-phenyl-1,3-thiazole
30713-31-6 3-Amino-5-(aminomethyl)-benzoic acid
30717-55-6 Bis-(3-methyl-2-thiophenyl)-methanone
30718-17-3 (Cyanomethyl)-trimethylsilane
30719-21-2 Tetradecanoic-2,2-d2 acid
30719-28-9 Hexadecanoic-4,4-d2 acid
30725-00-9 2,3-O-Isopropylidene-D-ribono-1,4-lactone
30727-14-1 1-Ethyl-3-pyrrolidinol
30727-18-5 Ethyl 1-methyl-2-piperidinecarboxylate
30736-07-3 Di-t-butyl silane
30745-55-2 Bis-(2-ethylhexanato-O)-hydroxyaluminum
30748-15-3 Glycerol-2-d1
30748-29-9 PRENAZONE
30748-47-1 5-Acetyl-2-amino-4-methylthiazole
30749-25-8 3-Iso-butylphenol
30750-23-3 1,4-Dihydro-4-oxo-2-quinazolineacetonitrile
30751-05-4 Troxipide
30752-18-2 4-Bromo-(pentyloxy)-benzene
30752-19-3 4-Bromo-(hexyloxy)-benzene
30760-09-9 Methyl 1-thio-β-D-glucopyranoside
30762-00-6 4-Isobutoxybenzoic acid
30766-03-1 4-Bromo-α-picolinic acid
30766-11-1 5-Bromo-α-picolinic acid
30766-12-2 5-Hydroxy-pyridine-2-carboxylic acid methyl ester
30766-22-4 5-Hydroxynicotinic acid methyl ester
30772-69-1 Octahydro-4,7-methano-1H-indenemethyl acetate
30772-79-3 Octahydro-4,7-methano-1H-indenecarboxaldehyde
30778-27-9 1-(3,3-Diphenyl-2-propenyl)-piperidine hydrochloride
30806-83-8 4-Isocyanatobenzoic acid ethyl ester
30811-19-9 3-(4-Hydroxyphenyl)-3,5-d2-L-alanine
30811-79-1 D-Glutamic acid 1-sodium salt homopolymer
30811-80-4 Poly Cytidysic Acid (Poly C)
30812-87-4 Dibromoethylbenzene
30818-17-8 2,4-Dihydro-2-(4-nitrophenyl)-5-(1-pyrrolidinyl)-3H-pyrazol-3-one
30820-22-5 GRANDLURE I
30827-99-7 AEBSF
30838-93-8 2-Chloro-4,6-dimethylpyridine
30841-93-1 3,5-Difluoro-2,4,6-tribromopyridine
30842-90-1 3-Methylisoxazole
30843-69-7 1,3,4-Thiadiazole-2,5-dithioacetic acid
30845-78-4 1-Anthraquinonesulfonic acid potassium salt
30851-76-4 Ethoxazorutoside
30868-50-9 Magnesium hexafluorozirconate
30868-51-0 Calcium hexafluorozirconate
30877-30-6 5,6-Dimethylindole
30877-80-6 1-[3-Nitro-4-(piperidin-1-yl)-phenyl]-ethanone
30896-98-1 6,7,8-Trimethoxy-2,4-(1H,3H)-quinazolinedione
30899-19-5 Pentanol, isomer mixture
30903-10-7 2,4-Diamino-6-(1-trifluoromethyl-2-oxaoctafluoropentyl)-1,3,5-triazine
30903-87-8 2,2'-Bipyridine
30909-51-4 Flupentixol Decanoate
30918-54-8 Poly Inosinic Acid (Poly I)
30922-25-9 Dihydro-1H-indole
30924-31-3 Cafaminol
30924-93-7 N-tert-Butoxycarbonyl-L-glutamic acid 2-benzyl ester
30925-07-6 L-Cystine HCL Monohydrate
30925-11-2 Nα-tert-Butoxycarbonyl-Nα-methyl-L-phenylglycine
30925-18-9 Nα-tert-Butoxycarbonyl-L-aspartic acid α-benzyl ester
30929-57-8 Cyclohexylhydrazine hydrochloride
30931-67-0 2,2'-Azinobis-(3-ethylbenzothiazoline-6-sulfonic acid)-diammonium salt
30934-97-5 2,2-dimethoxy ethanol
30937-38-3 Sulfur trifluoride
30944-92-4 Phenol Novolac Cyanate Ester
30948-01-7 Cholesteryl 10-undecenoate
30950-27-7 Perillaldehyde α-oxime
30955-94-3 1-(5-Iodothiophen-2-yl)-ethan-1-one
30958-52-2 Guarana Seed P.E.
30963-12-3 2-(1-Methylhydrazino)-3-nitropyridine
30964-13-7 1,5-Dicaffeoylquinic acid
30965-85-6 Sodium α-olefin-(C12)-sulfonate
30979-48-7 N-Isobutyl-2-oxoimidazolidine-1-carboxamide
30980-84-8 Iridium dioxide
30982-03-7 Isobutyl nonanoate
30984-53-3 3-(3-Fluorophenyl)-1-propene
30989-73-2 2-(Diethoxymethyl)-1,1-diethoxyheptane
30989-81-2 3-Amino-2-methacrylaldehyde
30991-42-5 O-Cresotic Hydrazide
30992-29-1 Boc-alpha-Methylalanine
30994-23-1 Dimethyl succinate-d4
31001-77-1 Dimethoxy-(3-mercaptopropyl)-methylsilane
31002-79-6 Triamcinolone
31005-02-4 7-Ethoxycoumarin
31005-04-6 7-(Phenylmethoxy)-2H-1-benzopyran-2-one
31008-64-7 Adenosine-5'-diphosphoric acid trilithium salt
31009-31-1 8-Fluoro-4-hydroxy-2-(trifluoromethyl)-quinoline
31014-51-4 Acrylamide(AM)
31017-83-1 α,α'-[(Dodecylimino)-di-2,1-ethanediyl]-bis-(ω-hdyroxypoly-(oxy-1,2-ethanediyl)]
31024-46-1 3-(N-Allylamino)-propyltrimethoxysilane
31024-91-6 DL-Alanine-2-d1
31027-31-3 4-Isocyanatocumene
31036-80-3 Lofexidine
31037-02-2 5-Amino-1-methyl-1H-pyrazole-4-carboxylic acid ethyl ester
31039-74-4 N-Phenyltetrachlorophthalimide
31058-81-8 2-Chloro-4-(N,N-dimethylamino)-pyrimidine
31062-20-1 N-Benzyloxycarbonyl-D-norleucine 4-nitrophenyl ester
31075-24-8 WSCP
31077-88-0 2-Deoxy-2-fluoro-D-mannosepyranose
31081-24-0 Tetrahydrothiophene-2,2,5,5-d4
31083-13-3 2-(Trifluoromethyl)-benzoic acid ethyl ester
31084-42-1 3,5-Dibromo-4-oxo-2,2,6,6-tetramethyl-1-piperidine N-oxide
31090-12-7 4-Methyl-2-thioxo-3(2H)-thiazoleacetic acid
31093-48-8 Isopropylnaphthalenesulfonic acid, isomer mixture
31101-37-8 2-(1-Piperidinyl)-1,3-thiazol-4-one
31105-01-8 Fructose-glutamic acid
31105-90-5 3-(3,4-Difluorophenyl)-L-alanine
31105-91-6 3-(3,5-Difluorophenyl)-L-alanine
31105-92-7 2,5-Difluoro-L-Phenylalanine
31105-93-8 2,4-Difluoro-L-Phenylalanine
31106-82-8 2-(Bromomethyl)-pyridinehydrobromide
31108-57-3 4-Pyrazolecarbonitrile
31111-21-4 Potassium ruthenate
31118-87-3 N-(2,4,6-Trichlorophenyl)-2-thiourea
31126-81-5 Rhodium(II) propionate
31126-82-6 Rhodium benzoate
31126-95-1 Bis-(trifluoroacetic acid rhodium salt)
31127-82-9 Iodoxamic acid
31130-15-1 5-(4-Methylphenyl)-1,3,4-oxadiazole-2-thiol
31130-17-3 5-Methyl-1,3,4-oxadiazole-2-thiol
31137-74-3 (2S,4R)-4-Methylglutamic acid
31139-36-3 Pyrocarbonic acid dibenzyl ester
31139-87-4 Tipepidine Hibenzate
31155-09-6 2,3-Dichlorobenzaldehyde
31164-13-3 1-Acetyl-3-methylene-4-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)-pyrrolidine
31165-67-0 2'-(Benzyloxy)-acetophenone
31166-29-7 4,5-Dichloro-2-thiophenecarboxylic acid
31166-44-6 N-Benzyloxycarbonylpiperazine
31167-05-2 5-Ethyl-2,4-bis-[(trimethylsilyl)-oxy]-pyrimidine
31169-25-2 7-Bromo-1H,4H-thieno[3,2-d]pyrimidin-4-one
31169-27-4 7-Bromo-4-chlorothieno[3,2-d]pyrimidine
31177-92-1 1,2-Bis-(4-hydroxyphenyl)-o-carborane
31181-53-0 5-Fluoro-α-picoline
31181-64-3 5-Bromo-α-picoline N-oxide
31181-88-1 5-Fluoro-2-formylpyridine
31181-89-2 5-Chloro-2-formylpyridine
31181-90-5 5-Bromo-2-pyridinecarboxaldehyde
31182-22-6 N,N'-Di-sec-butylthiourea
31188-91-7 3-{{[2,4-Bis-(1,1-dimethylpropyl)-phenoxy]-acetyl}-amino}-N-[4,5-dihydro-5-oxo-1-(2,4,6-trichlorophenyl)-1H-pyrazol-3-yl]-benzamide
31188-99-5 4'-{[(Piperidinyl)-carbonyl]-methoxy}-acetophenone
31197-30-5 1-(3-Bromophenyl)-piperazine
31202-69-4 Nε-tert-Butoxycarbonyl-D-lysine
31224-43-8 3-Fluoropicolinaldehyde
31224-82-5 5-(Trifluoromethyl)-pyridine-2-carboxaldehyde
31224-92-7 Pifoxime
31230-17-8 5-Amino-3-methylpyrazole
31238-20-7 (2-Chloroethyl)-triphenylphosphonium bromide
31240-52-5 (Benzyl)-triphenylphosphonium tetrafluoroborate
31241-19-7 5-Methoxy-2,3,3-trimethyl-3H-indole
31248-39-2 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine platinum complex
31249-95-3 1,17-Diaza-15-crown-5
31250-80-3 1-Benzyl-2,4,5-tribromo-1H-imidazole
31251-03-3 1-[Diphenyl-[3-(trifluoromethyl)-phenyl]-methyl]-1H-1,2,4-triazole
31251-41-9 8-Chloro-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-one
31252-42-3 4-Benzylpiperidine
31255-14-8 2,2'-[Oxybis-(ethane-2,1-diyloxyethane-2,1-diyl)]-bis-(1H-isoindole-1,3(2H)-dione)
31255-57-9 3-[2-(3-Chlorophenyl)-ethyl]-2-pyridinecarbonitrile
31264-51-4 3-(2,5-Xylyloxy)-propionyl chloride
31270-80-1 4-Chlorofuro[3,2-c]pyridine
31271-07-5 Gamma-mangostin
31277-98-2 Bis-[1,2-bis-(diphenylphosphino)-ethane]-palladium
31281-86-4 8-Bromo-2',3',5'-tri-O-acetyladenosine
31282-04-9 Hydrocodone
31283-43-9 2-Chloro-1-octene
31291-59-5 Diisopropyl-3-methylphenol
31291-60-8 2,6-Di-sec-butylphenol
31294-91-4 3-Iodohexane
31295-41-7 5,6-Diamino-2,4(1H,3H)-pyrimidinedithione;2,4-Dimercapto-5,6-diaminopyrimidine
31295-66-6 4-Iodo-5-methyl-3-phenylisoxazole
31301-45-8 3,5-Dimethylisoxazole-4-carbonyl燾hloride
31301-51-6 2-Chloro-5-fluoropyridine
31305-94-9 4,4'-Methylenebis-[N,N-bis-(2,3-epoxypropyl)-aniline] homopolymer
31308-55-1 Octahydro-4,7-methano-1H-indenemethanol
31319-90-1 8-Benzylaminoadenosine-3',5-cyclic monophosphoric acid
31321-68-3 (2R)-2-Piperazinecarboxylic acid
31323-44-1 Octachlorotrisiloxane
31328-31-1 4'-[4-(2-Chlorostyryl)-phenyl]-2-stilbenesulfonic acid sodium salt
31329-64-3 4-Amino-3,5-dimethylisoxazole
31333-13-8 3-Nonyn-1-ol
31350-31-9 N-Cyanocarbonimidodithioic acid S,S'-dibenzyl ester
31352-82-6 Zolazepam
31356-95-3 8-Hydroxyadenosine-3',5'-monophosphoric acid
31357-06-9 8-Piperidinoadenosine-3',5'-cyclic monophosphoric acid sodium salt
31366-25-3 Tetrathiafulvalene
31375-11-8 N-(Tetrafluoroethyl)-N-methylbenzenesulfonamide
31375-17-4 Nerone
31377-05-6 Pyroglutamic acid calcium salt
31377-23-8 Amantadine sulphate
31377-28-3 Creatinine sulfate
31385-63-4 [5-Bromo-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl]-acetic acid
31394-54-4 Isoheptane
31394-71-5 Polypropyleneglycol monooleate
31399-83-4 3-(2-Chloro-4-nitrophenyl)-5-(tert-butyl-dimethylethyl)-1,3,4-oxadiazol-2(3H)-one
31399-84-5 3-(4-Amino-2-chlorophenyl)-5-(tert-butyl-dimethylethyl)-1,3,4-oxadiazol-2(3H)-one
31402-54-7 5-Bromo-2-(methylamino)-pyrimidine
31405-28-4 4,5-Bis-(4-chlorophenyl)-4H-1,2,4-triazole-3-thiol
31406-67-4 Tetrabenzylhafnium
31406-95-8 4-(2-Bromoethoxy)-phenol
31407-25-7 2-Amino-3-cyanoquinoline
31407-29-1 2-Amino-3-quinolinecarboxylic acid
31407-74-6 O-Ethylisourea hydrochloride
31408-17-0 2-Amino-5-(4-tolyl)-pyrimidine
31408-47-6 5-(4-Methoxyphenyl)-2-pyrimidinamine
31410-01-2 1-Allylimidazole
31419-81-5 3,5-Dibromo-4-methoxybenzamidoxime
31428-61-2 Tiamenidine
31430-15-6 Flubendazole
31430-18-9 Nocodazole
31430-41-8 6-Amino-5-chloro-β-picoline
31430-47-4 2-Amino-3,5-dichloro-4-methylpyridine
31431-16-0 4-Chloro-4'-fluoro-3-nitrobenzophenone
31431-19-3 4-Amino-3-nitrobenzophenone
31431-26-2 4-Amino-4'-fluoro-3-nitrobenzophenone
31431-30-8 2-(4-Amino-3-nitrobenzoyl)-thiophene
31431-39-7 MEBENDAZOLE
31431-43-3 Ciclobendazole
31437-05-5 Pyrazin-2-yl-thiourea
31456-71-0 (2S)-1,2,3,6-Tetrahydropyridine-2-carboxylic acid
31457-07-5 2-Methyl-7-benzofurancarboxylic acid
31458-36-3 6-Fluorothymine
31458-45-4 4,6-Diamino-2-pyrimidinol
31461-61-7 H-Glu-Val-Phe-OH
31462-58-5 5-Iodopyrimidine
31462-59-6 4-Pyrimidinecarboxylic acid
31465-35-7 4-(4-Bromophenoxy)-aniline
31465-36-8 4-(4-Methoxyphenoxy)-aniline
31466-47-4 2-(4-Methoxyphenyl)-2-(4-morpholinyl)-ethanamine
31469-15-5 [(1-Methoxy-2-methyl-1-propenyl)-oxy]-trimethylsilane
31477-60-8 Centchroman
31478-45-2 Bamnidazole
31493-66-0 1-Methyl-4-nitrobenzimidazole
31499-72-6 Dihydro-α-ionone
31501-11-8 cis-3-Hexen-1-yl hexanoate
31506-43-1 N-(3-Dimethylaminopropyl)-urea
31508-00-6 2,3',4,4',5-Pentachlorobiphenyl
31512-74-0 Polyquats
31519-62-7 2-Carboxypyrimidine
31528-44-6 Mycophenolic acid β-D-glucuronide
31529-46-1 2,3-Dihydro-2-methyl-1H-indol-1-amine
31535-89-4 1,10-Phenanthrolin-2(1H)-one, 1-methyl-
31541-57-8 4-Carboxy-3,4-dihydro-2H-1-benzopyran-4-acetic acid
31542-62-8 1,3-Dipropylxanthine
31542-63-9 1,3-Dipropyl-7-methylxanthine
31543-75-6 2,4-Dibromotoluene
31551-45-8 2,7-Dinitro-9-fluorenone
31556-45-3 Tridecyl stearate
31557-57-0 2-Chloro-3-phenylpyridine
31558-40-4 4-Bromo-3,5-dimethoxybenzaldehyde
31560-20-0 trans-1-Benzoyl-4-hydroxy-L-proline methyl ester
31562-43-3 Tert-Butylsulfinyl chloride
31564-28-0 Baicalin
31565-37-4 Isotridecyl stearate
31565-38-5 Isodecyl octadecanoate
31566-31-1 Glyceryl monostearate
31570-04-4 Tris-(2,4-di-tert-butylphenyl)-phosphite
31574-87-5 2,8-Dibromodibenzothiophene
31575-35-6 2-Fluoropyrimidine
31575-75-4 2-(Benzyloxy)-bromobenzene
31582-45-3 2,2,6,6-Tetramethyl-4-piperidinyl methacrylate
31586-77-3 Bismuth sodium tartrate
31587-81-2 Polyethyleneglycol N,N-bis-(2-hydroxyethyl)-stearamide ether
31588-95-1 6,8-Dichloro-4-(2-pyridyl)-3-quinolinecarboxylic acid ethyl ester
31591-08-9 N,N-Dimethyl-d6-acetamide
31594-45-3 2-Ethoxy-5-nitropyridine
31599-60-7 3-Iodo-o-xylene
31599-61-8 4-Iodo-o-xylene
31602-09-2 Ethyl 4-chloro-6,8-dimethylquinoline-3-caboxylate
31602-63-8 5-Aminomethyltetrazole
31603-77-7 Biphenylacetonitrile
31605-03-5 4-(Diethylamino)-2-ethoxybenzenediazonium chloride zinc chloride complex
31618-80-1 3-Methyl-5-(2-thienyl)-1H-pyrazole
31618-90-3 Diethyl(tosyloxy)methylphosphonate
31635-99-1 Sodium mesoxalate
31637-97-5 Etofibrate
31645-39-3 Palifosfamide
31648-54-1 3-N-Benzyloxycarbonyl-aminopiperidine
31657-37-1 4-Decyloxynitrobenzene
31676-54-7 3-Amino-5-phenylpyridine
31676-55-8 3-Hydroxy-5-phenylpyridine
31677-93-4 Bupropion Hydrochloride
31677-93-7 Amfebutamone(Bupropion)
31680-07-6 4-Methyl-3-nitrobenzaldehyde
31680-08-7 3-Nitro-p-anisaldehyde (CHO=1)
31681-98-8 2-Naphthyl phosphate disodium salt
31687-58-8 Nα,Nim-Bis-(tert-butoxycarbonyl)-L-histidine dicyclohexylamine salt
31691-97-1 Polyethyleneglycol 4-nonylphenyl ether ammonium sulfate
31692-79-2 α-Hydro-ψ-hydroxypoly-[oxy-(dimethylsilylene)]
31692-86-1 Polyethyleneglycol furfuryl ether
31694-55-0 Polyethyleneglycol glyceryl ether
31697-20-8 5-(Methylthio)-6-azauracil
31698-14-3 Ancitabine
31699-61-3 3-Indoxylphosphate p-toluidine salt
31719-76-3 4-(Phenoxymethyl)-benzoic acid
31719-77-4 3-(Chloromethyl)-benzoic acid
31720-89-5 5-Acetoxy-indolecarboxylic acid ethyl ester
31721-17-2 Quinupramine
31722-49-3 2-Cyanoimidazole
31726-34-8 Polyethyleneglycol monohexyl ether
31739-63-6 2-(1-Pyrrolyl)-benzhydrazide
31748-45-5 3-Cyano-2-methyl-2H-indazole
31752-99-5 (-)-4-Phenylbenzoyl corey lactone
31770-95-3 5-Methanesulfonyl-6-nitro-3H-benzooxazol-2-one
31793-07-4 Pirprofen
31793-29-0 4-Amino-3,5-dinitropyridine
31795-93-4 N-Benzyl-L-proline
31796-55-1 L-Alanine-4-nitroanilide hydrochloride
31803-00-6 2-Amino-5-benzyl-1,3,4-oxadiazole
31807-55-3 Isododecane
31821-72-4 4-Amino-3-mercapto-5-(methoxymethyl)-1,2,4-triazole
31823-41-3 Carbidopa
31823-43-5 (Z)-3-nonenal
31827-04-0 3-Hydroxy-2-indolecarboxylic acid methyl ester
31828-50-9 Cefradine
31828-68-9 (S)-3-Aminodihydrothiophen-2(3H)-one hydrochloride
31828-71-4 Mexiletine (base and/or unspecified salts)
31835-02-6 Sucrose monolinoleate
31835-06-0 Sucrose monocaprate
31837-42-0 Pigment yellow 151
31842-01-0 Indoprofen
31844-98-1 1-Bromo-1-butene
31848-01-8 Morclofone
31868-18-5 Mexazolam
31872-61-4 4-Methoxy-3-nitropyridine hydrochloride
31872-62-5 4-Methoxy-3-nitropyridine
31872-63-6 3-Bromo-4-chloro-5-nitropyridine
31874-34-7 N-[(2,4-Dimethoxyphenyl)-methylidene]-hydroxylamine
31879-05-7 FENOPROFEN
31883-05-3 Moricizin
31884-77-2 Meclizine hydrochloride
31885-97-9 Polyethyleneglycol dibutyl ether
31886-51-8 Bis-(1-ethyl-2,4-cyclopentadienyl)-nickel
31891-06-2 2-Amino-3-thiophenecarboxylic acid ethyl ester
31895-21-3 Thiocyclam
31895-22-4 Thiocyclam hydrogen oxalate
31896-10-3 N-(2,2,2-Trichloro-1-(1-piperazinyl)ethyl)-formamide
31896-11-4 N-(2,2,2-Trichloro-1-(1-piperazinyl)-ethyl)-formamide hydrochloride
31904-29-7 Butylferrocene
31904-34-4 Alpha-(N,N-Dimethylamino)ethylferrocene
31904-79-7 Chloro-(2,4-cyclopentadienyl)-(triphenylphosphine)-nickel
31906-04-4 4-(4-Hydroxy-4-methylpentyl)-3-cyclohexene-1-carboxaldehyde
31910-18-6 2,3-Dihydroxy-6-methoxyquinoxaline
31914-94-0 2,4-Dichloro-5-[(cyclopropylamino)-sulfonyl]-benzoic acid
31915-82-9 Isonitrosoacetone
31923-86-1 1,2-Propanediol, polymer with ethyloxirane
31928-47-9 4-Bromo-2-chloroiodobenzene
31932-09-9 Ticarbodine
31938-07-5 3-Bromobenzyl cyanide
31938-11-1 O-Triphenylmethanehydroxylamine
31949-21-0 2-Bromo-2'-methoxyacetophenone
31954-27-5 Nα-tert-Butoxycarbonylglycine methyl ester
31966-52-6 8-Azidoadenosine-3',5'-cyclic monophosphoric acid sodium salt
31968-33-9 2-Acetyl-3-aminothiophene
31970-04-4 1-Benzyloxycarbonyl-3-pyrroline
31972-52-8 (N-tert-Butyloxycarbonyl)-glycylglycine
31980-29-7 Nicofibrate
31981-44-9 Gestonorone Acetate
31982-78-2 L-Leucine hydroxamate
31983-27-4 Citrylnitrile
31994-60-2 2-tert-Butyl-4-(α-carbethoxytridecyloxy)-phenol
32001-55-1 Hydrogen Fluoride-Pyridine
32002-24-7 3,3-Diethoxyacrylic acid ethyl ester
32004-66-3 5-Fluoro-2-methyl-1H-indene-3-acetic acid
32004-67-4 Sulindac sulfide
32008-59-6 Paraformaldehyde-d2
32014-70-3 4,5-Diamino-2,6-dihydroxypyrimidine
32024-15-0 5-Iodoveratraldehyde
32039-21-7 5-Amino-3-isopropyl-1,2,4-thiadiazole
32042-43-6 DL-Arginine hydrochloride
32043-95-1 2-Methyl-4-phenyl-5-thiazolecarboxylic acid ethyl ester
32046-62-1 5-Bromo-1H-benzotriazole
32046-75-6 N-(3-butoxy-2-hydroxypropyl)-N-(carboxymethyl)-glycine monosodium salt
32047-53-3 Dimethyl cysteamine hydrochloride
32064-67-8 tert-Butylhydrazine
32072-96-1 1-Hexadecenylsuccinic anhydride
32081-28-0 4-Chloro-5,6-benzoisoquinoline
32082-74-9 (R)-β-Butyrolactone
32084-55-2 2,3-Dihydro-5-oxo-5H-thiazolo[3,2-a]pyrimidine-6-carboxylic acid
32085-88-4 3,5-Difluorobenzal-dehyde
32111-21-0 2-Iodopyrazine
32111-34-5 4-(2-Pyridyl)-benzonitrile
32113-85-2 Methyl acetate-d6
32115-08-5 N6-Benzyladenosine-3',5'-cyclic monophosphoric acid sodium salt
32118-33-5 4-Bromo-3-chloroisothiocyanatobenzene
32122-11-5 4-(Benzyloxy)-benzoic acid methyl ester
32128-65-7 Polyethyleneglycol 2-octyldodecyl ether
32131-17-2 Polyamide 66
32133-36-1 3-(3,4-Difluorophenyl)-DL-alanine
32133-37-2 3,5-Difluoro-dl-phenylalanine
32133-38-3 3-(2,5-Difluorophenyl)-DL-alanine
32133-39-4 2,6-Difluoro-dl-phenylalanine
32134-06-8 D-α-Phenylglycine dane salt sodium ethyl
32137-73-8 2-(Trimethylsilyl)-benzthiazole
32137-76-1 Ethyl benzothiazole-2-carboxylate
32140-49-1 3-Hydroxy-D-phenylalanine
32159-21-0 N-Benzyloxycarbonyl-L-pyroglutamic acid
32161-06-1 N-Acetyl-4-piperidone
32161-30-1 L-Veratrylglycine
32164-02-6 D-erythro-Sphinganine
32175-00-1 trans-4-Methylcyclohexyl isocyanate
32176-12-8 Trimethyl-d9 phosphate
32178-39-5 2,5-Diethoxy-4-(4-morpholinyl)-benzene diazonium sulfate
32190-42-4 2,2'-Dipyridyl-d8
32202-61-2 4-Aminoindane
32210-23-4 4-tert-Butylcyclohexyl acetate
32212-61-6 5β-Androstane-3α,11α,17β-triol
32212-64-9 5α-Androstane-3α,11β,17β-triol
32212-65-0 5α-Androstane-3β,11β,17β-triol
32213-95-9 Dimethyl L-aspartate hydrochloride
32214-91-8 Caryophyllene alcohol acetate
32221-81-1 Monosodium glutamate
32222-06-3 Calcitriol
32223-70-4 4-(Hexyloxy)-isocyanatobenzene
32223-72-6 4-Isocyanato-(octyloxy)-benzene
32231-06-4 1-Piperonylpiperazine
32231-50-8 (R)-(-)-2-Methylbutyric acid
32233-40-2 (-)-Corey Lactone diol
32233-43-5 1,3-Dioxolane-4-ethanol, 2,2-dimethyl-,
32233-44-6 1,3-Dioxolane-4-acetaldehyde, 2,2-dimethyl
32235-52-2 1-Methylpiperidin-4-ol hydrobromide
32238-28-1 Adipic acid/1,4-butanediol/methylene-p-phenylene isocyanate/2,2'-(p-phenylenedioxy)-diethanol copolymer
32246-20-1 5-Bromo-2,4-dimethoxybenzoic acid
32247-96-4 3,5-Di(Trifluoro Methyl)Benzyl Bromide
32248-43-4 Samarium(II) iodide
32253-75-1 5-Bromo-N-(carboxymethyl)-anthranilic acid
32263-00-6 2,3-Dimethyl-5-sec-butylpyrazine
32265-82-0 4-Bromo-2,6-dimethylisothiocyanatobenzene
32281-01-9 4-Mercapto-2-methylphenol
32289-58-0 Poly (hexamethylene biguanide) hydrochloride
32302-76-4 Glycyl-L-prolyl-L-glutamic acid
32305-98-9 (-)-1,4-Bis-(diphenylphosphino)-2,3-dihydroxy-2,3-O-isopropylidenebutane
32314-39-9 4-Chloro-2,8-dimethylquinoline
32315-10-9 Bis(trichloromethyl) carbonate
32324-19-9 N-Methyl-benzenesulfonyl Isocyanate
32328-03-3 3-Hydroxy-1,5-pentanedioic acid diethyl ester
32329-20-7 3,4-Dihydro-3-methyl-2H-1,4-benzoxazine
32332-98-2 3-(2-Furyl)-1H-pyrazole
32338-02-6 2-Bromo-p-anisidine
32339-03-0 N-Benzylsulfanilic acid sodium salt
32339-43-8 (Decyl)-triphenylphosphonium bromide
32345-29-2 O,O-Diethyl-O-phenylphosphorothioate
32354-50-0 (Bicyclo[2.2.1]-2,5-heptadiene)-(2,4-pentanedionato)-rhodium
32358-94-4 5'-Methyl-2,2'-bithienyl-5-carboxaldehyde
32359-34-5 Medifoxamine
32362-65-5 2-Butyl-4,4,6-trimethyl-1,3-dioxane
32362-88-2 1,2-Dihydro-5-(3-pyridinyl)-3H-1,2,4-triazole-3-thione
32363-45-4 4-Chloro-3'-methoxybenzophenone
32363-46-5 3-Chloro-3'-methoxybenzophenone
32376-17-3 tert-Butyldimethylphosphine
32376-20-8 tert-Butyldiethylphosphine
32381-18-3 α-Methyl-DL-histidine dihydrochloride
32383-03-2 2,3-Dimethyl 6-chloropyridine-2,3-dicarboxylate
32383-10-1 6-Methoxy-2-methyl-3-pyridineacetonitrile
32385-06-1 Methyl-α-L-daunosaminide hydrochloride
32385-58-3 5-[2-(Imidazol-4-yl)-ethyl]-isothiouronium dihydrobromide
32387-21-6 1-Methyl-3-indolecarboxylic acid
32388-00-4 6,7-Dimethoxy-2,3-dimethylquinoxaline
32388-55-9 Cedryl methyl ketone
32393-32-1 (1-Isothiocyanatoethyl)-benzene
32399-12-5 2-(N-Methylamino)-3-hydroxymethylpyridine
32411-27-1 2,5-DIMETHYL-1-(P-TOLYL)-PYRROLE
32418-26-1 5-(Amino-1,3,4-thiadiazol-2-ylthio)-acetic acid
32419-58-2 3-Deoxolevonorgestrel
32421-46-8 Bunaftine
32426-11-2 N,N-Dimethyl-N-octyl-1-decanaminium chloride
32431-93-9 4-Bromo-2-chlorothiophene
32438-31-6 (2,2-Diethoxyethoxy)-benzene
32440-50-9 1-Hexadecene-1-vinyl-2-pyrrolidone copolymer
32443-95-5 D-Cysteine HCl Monohydrate
32443-99-5 D-Cysteine Hydrochloride Monohydrate
32445-18-4 Terephthalic acid bis-(hydroxymethylamide)
32445-66-5 4,4'-Dicyanobenzophenone ( For Letrozole )
32449-41-5 6-Bromo-7-hydroxy-5-methyl-1,2,4-triazolo[1,5-a]pyrimidine
32449-92-6 D-Glucuronolactone
32449-99-3 N-(3-Indolylacetyl)-DL-aspartic acid
32457-96-8 2,5-Dibutoxy-4-morpholinobenzene diazonium chloride zinc chloride salt
32459-62-4 4-Isocyanatophenetole
32460-00-7 2,5-Dibromofuran
32460-02-9 3,4-Dibromofurane
32462-30-9 Oxfenicine
32465-18-2 9-β-D-Arabinosyladenine-3',5'-cyclic monophosphate
32472-85-8 2,2'-Oxybis-(ethanol)-1,3-isobenzofurandione polymer
32477-35-3 Heptafluorobutyrylimidazole
32487-38-0 8-(Benzylthio)-adenosine 3',5'-cyclic-(hydrogenphosphate)
32492-61-8 Ethoxylated Bisphenol A
32499-64-2 N-Carbethoxy-4-tropinone
32501-05-6 1,3-DIHYDRO-2H-PYRROLO[3,2-B]PYRIDIN-2-ONE
32503-27-8 Tetrabutylammonium hydrogen sulphate (tbahs)
32503-34-7 Tetrahexylammonium hydrogen sulphate
32507-66-7 Isorhapontigenin
32509-66-3 Ethyleneglycolbis-[3,3-bis-(tert-butyl-4-hydroxyphenyl)-butyrate]
32510-27-3 2-Mercaptobenzothiazole copper salt
32511-34-5 (R)-(+)-Bornylamine
32517-36-5 Tirasol Blue Black
32527-55-2 Tiaramide
32534-81-9 Pentabromodiphenyl ether, isomer mixture
32536-52-0 Octabromodiphenyl ether, isomer mixture
32539-16-5 2-(Methylthio)-5-(trifluoromethyl)-1,3-4-thiadiazole
32543-38-7 DL-Carnitine Orotate
32545-75-8 (4-Morpholinylmethylene)-bis-(phosphonic acid)
32565-18-7 7-Chloro-3-methyl-2-benzofurancarboxylic acid
32566-01-1 2-(2-Indolyl)-aniline
32569-86-1 4-(tert-Butoxy)-phenylacetylene
32570-10-8 2,5-Dimethyl-N-(3-methylphenyl)-pyrrole
32572-90-0 Sodium hexabromorhodium
32580-00-0 2,4:3,5-Di-O-benzylidene aldehydo-D-ribose
32580-26-0 2-(2-Bromoacetamido)-5-chlorobenzophenone
32582-32-4 2-Tetradecyl-1-octadecanol
32587-10-3 3-Aminopyrazine-2-carboxamide
32587-64-7 2,2'-DIMETHYLBIPHENYL
32588-36-6 Indole-2-acetic acid
32588-54-8 2-tert-Amylanthraquinone
32588-76-4 Ethylene Bis(tetrabromophthalimide)
32589-62-1 2,5-Dihydro-5-oxo-1-phenyl-1H-1,2,4-triazole-3-carboxylic acid phenylamide
32595-59-8 3-(2-Thienyl)-DL-serine
32598-11-1 2,3',4',5-Tetrachlorobiphenyl
32598-12-2 2,4,4',6-Tetrachlorobiphenyl
32598-13-3 3,4,3',4'-Tetrachlorobiphenyl
32598-14-4 2,3,3',4,4'-Pentachlorobiphenyl
32601-86-8 2-Chloro-3-methylquinoxaline
32603-44-4 Adenosine-8-3H
32608-29-0 2,4-Dichloro-8-methylquinoline
32609-14-6 ARABIC ACID
32612-48-9 Ammonium Lauryl Ether Sulfate (AESA)
32618-85-2 2,4-Dihydroxy-6-nitroquinazoline
32619-42-4 Oleuropein
32620-11-4 O-Methyl-L-serine
32624-68-7 Di-P-Toluoyl-D-Tartaric Acid
32627-52-4 Sodium iron chlorophyllin
32628-06-1 Polyethyleneglycol dipalmitate
32634-35-8 5-Cyano-1-ethyl-2-methyl-3-(4-sulfobutyl)-1H-benzimidazolium
32634-37-0 5,6-Dichloro-1-ethyl-2-methyl-3-(4-sulfobutyl)-1H-benzimidazolium inner salt
32634-66-5 L-DTTA
32634-68-7 D-DTTA
32647-67-9 Dibenzylidene-D-sorbitol
32648-01-4 DIBUTYRIN
32654-40-3 2-Amino-3-methylpyridine hydrochloride
32654-45-8 2-Aminopyridine hydrochloride
32659-21-5 Ethyl geranate
32659-49-7 (S)-2-Bromobutyric acid
32665-23-9 Isopropyl isovalerate
32665-36-4 Eprozinol
32668-14-7 L-Glutamine methyl ester hydrochloride
32672-69-8 Mesoridazine besylate
32673-25-9 Di-tert-butylphenyl phosphine
32673-41-9 4-Imidazolylmethanol hydrochloride
32677-01-3 L-Glutamic acid di-tert-butyl ester hydrochloride
32679-02-0 Bis-(acetonitrile)-(1,5-cyclooctadiene)-rhodium(I)tetrafluoroborate
32683-00-4 2-Phenyl-4-imidazolecarboxylic acid ethyl ester
32687-78-8 3,5-Bis-(1,1-dimethylethyl)-4-hydroxybenzenepropanoic acid 2-{3-[3,5-bis-(1,1-dimethylethyl)-4-hydroxyphenyl}-1-oxopropyl}-hydrazide
32690-93-0 2,4,4',5-Tetrachlorobiphenyl
32692-19-6 5-Nitroindoline
32695-27-5 Dapsone hydroxylamine
32701-75-0 3,5-Dimethyl-4-pyrazoleacetic acid
32703-87-0 N-tert-Butoxycarbonyl-β-alanine-N-hydroxysuccinimide ester
32707-89-4 3,5-Bis(trifluoromethyl)benzyl alcohol
32710-65-9 2,6-Dichloroisonicotinonitrile
32717-65-0 Diacetone-L-sorbose
32718-18-6 BCDMH Tablet
32723-67-4 3-Methyl-p-anisaldehyde (CHO=1)
32726-24-2 Decamethoxine
32732-51-7 Adipic acid polymer/1,4-butanediol/ethyleneglycol/4-methyl-m-phenylene isocyanate
32737-13-6 3-Isopentyl-2-methoxypyrazine
32737-14-7 2-Ethoxy-3-methylpyrazine
32740-20-8 Hexane-1,1,1,6,6,6-d6
32741-11-0 2-tert-Butylpyrazine
32745-07-6 N-Nitrosodimethyl-1,1,1-d3-amine
32750-52-1 Hexahydropyridazine
32752-54-8 4-(Bromomethyl)-benzophenone
32760-80-8 (Cumene)cyclopentadienyliron(II) hexafluorophosphate
32764-98-0 6-(3-Pentenyl)-tetrahydro-2H-pyran-2-one
32767-18-3 Oxygen-18
32768-54-0 2,3-DICHLOROTOLUENE
32770-99-3 2-Methylbenzothiazol-5-ylamine dihydrochloride
32779-36-5 5-Bromo-2-chloropyrimidine
32779-38-7 2-Chloro-5-iodopyrimidine
32780-06-6 (S)-τ-(Hydroxymethyl)-τ-butyrolactone
32780-32-8 Bremelanotide
32780-64-6 Labetalol hydrochloride
32785-94-7 3-Chloro-3-deoxy-1,2:5,6-di-O-isopropylidene-α-D-glucofuranose
32791-84-7 Panaxtriol
32793-04-7 Sodium tert-butylcarbonate
32795-58-7 6-Methoxy-2-phenyl-4-quinolinecarboxylic acid
32804-07-2 2-Chloro-3-fluoro-1-propene
32806-53-4 4-(2-Piperidinoethyl)-3-thiosemicarbazide
32807-28-6 Methyl Gamma-Chloroacetoacetate
32808-51-8 Bucloxic acid
32809-16-8 Procymidone
32813-24-4 2-Piperidinoethyl isothiocyanate
32813-48-2 4-(3-Morpholinopropyl)-3-thiosemicarbazide
32813-50-6 4-(3-Isothiocyanatopropyl)-morpholine
32814-29-2 Oleic-11,11-d2 acid
32819-24-2 Acetamidoethylmalonic acid diethyl ester
32830-97-0 1-Chloro-3-pentanone
32832-01-2 Cholesteryl 2,4-dichlorobenzoate
32834-71-2 Cholesteryl 3,4-dichlorobenzoate
32838-26-9 Butoctamide
32838-55-4 2-Benzylpiperidine
32841-83-1 1,1'-Ferrocenediboronic acid
32852-92-9 3'-Phenoxyacetophenone
32854-09-4 L-Cystine dimethyl ester dihydrochloride
32857-62-8 4-(Trifluoromethyl)-phenylacetic acid
32858-93-8 O-Trifluoromethoxyphenol
32861-85-1 Chlormethoxynil
32862-97-8 3-Bromocinnamic acid
32863-32-4 2,1,3-Benzoxadiazole-4-carbaldehyde
32864-29-2 2-Bromo-3-phenylpyridine
32864-38-3 Tert-Butyl Ethyl Malonate
32873-56-6 2-Acetamido-5-mercapto-1,3,4-thiadiazole
32876-92-9 Bis-(tert-butylcyclopentadienyl)-zirconium dichloride
32886-40-1 N-tert-Butoxycarbonyl-L-glutamic acid 5-benzyl N-hydroxysuccinimide ester
32886-43-4 N-tert-Butoxycarbonyl-O-benzyl-L-threonine N-hydroxysuccinimide ester
32887-01-7 Mecillinam
32888-88-3 2-Amino-5-chloroterephthalic acid
32889-74-0 3,5,6-trichloro-4-hydrazino-2-pyridinecarboxylic acid
32890-87-2 2,4-Bis-(trifluoromethyl)-benzoic acid
32890-94-1 2-Fluoro-6-(trifluoromethyl)-benzoic acid
32900-06-4 N-Butyl-N'-ethylthiourea
32900-08-6 1-Cyclopropyl-3-ethylthiourea
32900-09-7 N-Allyl-N'-ethylthiourea
32900-36-0 N-Methyl-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine
32908-42-2 (S)-1-Aminotetralin hydrochloride salt
32909-05-0 N4-Acetyl-2'-deoxycytidine
32916-07-7 Palladium(II) nitrate dihydrate
32926-43-5 N-[(1,1-Dimethylethoxy)-carbonyl]-1-(triphenylmethyl)-L-histidine
32934-08-0 Methyl 2.3.6-tri-O-acetyl-4-deoxy-4-fluoro-α-D-galactopyranoside
32946-56-8 1-(Triphenylmethyl)-L-histidine methyl ester hydrochloride
32953-14-3 N-Ethyl-3,4-(methylenedioxy)-aniline
32953-65-4 Octyl oleate
32953-89-2 Rimiterol
32954-43-1 Palmitamidopropyl betaine
32955-21-8 2-Amino-5-thiazolecarboxylic acid ethyl ester
32955-22-9 Ethyl 1,3-thiazole-5-carboxylate
32961-44-7 4-Chloro-3,5-diaminobenzoic acid isobutyl ester
32965-49-4 Chloro-(1,5-hexadiene)-rhodium(I) dimer
32974-92-8 2-Acetyl-3-ethylpyrazine
32977-83-6 Ethyl 3-methylthiophene-2-glyoxylate
32980-26-0 2,2'-Dimethyl succinic methyl ester
32980-71-5 2,4,6,8-Tetrachloropyrimido[5,4-d]pyrimidine
32981-85-4 Taxol side chain methyl ester
32986-56-4 TOBRAMYCIN
32988-39-9 3-Nitro-D-tyrosine
32990-47-9 4-Methyl-2-thiophenecarbonyl chloride
32991-58-5 5-(Methylthio)-3-phenyl-1,2,4-thiadiazole
32992-96-4 Bis-(1-ethyl-2,4-cyclopentadienyl)-ruthenium
32996-16-0 5-Indolecarboxylic acid ethyl ester
32998-00-8 2-Chloro-4,6-dihydroxy-1,3,5-triazine sodium salt
32998-04-2 2-Amino-4-chloro-6-(dimethylamino)-1,3,5-triazine
32998-95-1 N-tert-Butyl-3-methyl-2-pyridinecarboxamide
33005-95-7 Tiaprofenic acid
33007-83-9 1,1,1-Trimethylolpropane tris-(3-mercaptopropionate)
33008-06-9 Dansyl hydrazine
33008-07-0 3-Methylcrotonylglycine
33014-68-5 N-tert-Butoxycarbonyl-L-phenylalanyl-L-leucine
33016-12-5 3-(1-Anilinoethylidene)-5-benzyl-2,4-pyrrolidinedione
33016-47-6 1-(Triphenylmethyl)-4-imidazolecarboxaldehyde
33017-11-7 C-PEPTIDE (HUMAN)
33019-63-5 Methyl-2,3-O-isopropylidene-5-O-benzyl-β-D-ribofuranoside
33032-12-1 Methapyrilene fumarate
33033-86-2 Intermediate of Gantacurium Chloride
33034-67-2 2-Chloro-4-(trifluoromethyl)-pyrimidine
33036-67-8 2-Oxazolecarboxylic acid ethyl ester
33042-66-9 Spiro[indene-1,4'-piperidine]
33043-37-7 N-Acetyl-3-(3,4-dimethoxyphenyl)-D-alanine
33043-54-8 L-Serine N-carboxyanhydride
33043-58-2 L-Threonine N-carboxyanhydride
33043-60-6 ε-tert-Butoxycarbonyl lysine N-carboxyanhydride
33043-61-7 L-Glutamine N2-carboxyanhydride
33043-63-9 L-2,5-Dioxo-4-oxazolidineacetamide
33045-52-2 2-Methoxy-5-sulfamoylbenzoic acid methyl ester
33045-53-3 2-Methoxy-5-sulfamoylbenzoic acid ethyl ester
33048-69-0 Glyceryl trioctadecanoate-d110
33050-32-7 6-Chloro[1,2,4]triazolo[4,3-b]pyridazin-3(2H)-one
33054-18-1 3-Quinolineacetic acid ethyl ester
33059-05-1 2-Hydroxy-4-(isooctyloxy)-benzophenone
33064-36-7 1H-Pyrazole-3-carboxamide
33068-18-7 D-Mannose-6-phosphoric acid disodium salt
33069-62-4 Taxol
33083-43-1 5-[(Dimethylamino)-methyl]-1,3,4-oxadiazole-2-thiol
33089-36-0 21-Crown-7
33089-61-1 Amitraze
33090-69-6 Methyl 3-cyano-1H-pyrazole-4-carboxylate
33093-42-4 3,4,4'-Trichlorobenzophenone
33097-11-9 4,6-Dichloro-2-methylthio-5-pyrimidinecarboxaldehyde
33097-39-1 3,6-Difluoropyridazine
33099-08-0 Nα-Benzyloxycarbonyl-N-methyl-L-leucine
33100-27-5 15-Crown-5
33104-02-8 (Allyloxy)-pentafluorobenzene
33105-81-6 DL-tert-Leucine
33113-08-5 Ammonium copper carbonate
33115-06-9 Polyethyleneglycol-polypropyleneglycol triethanolamine ether
33117-68-9 5,6-Dihydro-1-methyl-4H-pyrrolo[3,2,1-ij]quinolin-2(1H)-one
33119-63-0 2-Amino-4,5-diphenyloxazole
33123-68-1 1,3-Oxazole-2-carboxylic acid
33125-05-2 Boc-D-phenylglycine
33125-86-9 Tetrakis-(2-chloroethyl)-ethylene diphosphate
33125-97-2 Etomidate
33130-03-9 2,3,4-Trimethoxycinnamic acid
33143-92-9 4-[(2-Methylbut-3-yn-2-yl)-oxy]-benzonitrile
33146-45-1 2,6-Dichlorobiphenyl
33148-54-8 2-Pivaloylbenzoic acid
33148-55-9 2'-Carboxy-2-phenylacetophenone
33155-90-7 10-Hydroxy-7,8-benzoquinoline
33159-27-2 Ecabet
33164-70-4 N-Acetyl-S-(3-hydroxypropyl-1-methyl)-L-cysteine dicyclohexylammonium salt
33166-77-7 1,3-Dihydro-Isobenzofuran-5-Yl-Amine
33173-53-4 4-Azido-L-phenylalanine
33173-55-6 N-tert-Butoxycarbonyl-3-(4-azidophenyl)-L-alanine
33174-74-2 2,2'-Dithiodibenzonitrile
33175-34-7 3,4-Dichlorophenylhydroxylamine
33178-86-8 Alinidine
33184-48-4 4-Chloro-2-iodotoluene
33204-76-1 Quadrosilan
33209-01-7 L-threonine amide hydrochloride
33216-38-5 1,2,5,6-Tetrahydro-2-(4-methoxybenzyl)-1,3,4-trimethylpyridine
33216-52-3 3,4,5 -Trichloropyridine
33224-02-1 rac-trans-3'-Hydroxymethylnicotine
33224-18-9 3,5-Dicyanonitrobenzene
33225-51-3 Maleic-2,3-d2 anhydride
33225-60-4 Isopropyl-1,1,1,2-d4 alcohol
33225-72-8 2-Nitronicotinic acid
33225-73-9 6-Nitronicotinic acid
33225-74-0 2-Nitroisonicotinic acid
33228-44-3 4-Pentylaniline
33228-45-4 4-Hexylaniline
33229-34-4 2-Nitro-N1,N4,N4-tris-(2-hydroxyethyl)-p -phenylenediamine
33229-89-9 N,N-Dimethylglycine Ethyl Ester
33233-67-9 N-tert-Butoxycarbonyl-4-(aminomethyl)-benzoic acid
33237-72-8 2-Anilinoindane
33243-33-3 2',4'-Dibromoacetophenone
33252-28-7 6-Chloropyridine-3-carbonitrile
33252-29-8 6-Chloro-2-cyanopyridine
33252-30-1 2-Chloroisonicotinonitrile
33252-32-3 2-Amino-4-ethylpyridine
33252-63-0 2-Hydroxy-5-(trifluoromethyl)-pyridine
33255-13-9 3,6-Dibromo-9-ethylcarbazole
33262-29-2 Dibenzothiophene-d8
33263-43-3 4-Chloro-3-pyridinesulfonamide
33263-46-6 4-Nitro-3-pyridinesulfonic acid
33263-48-8 4-{[3-(Trifluoromethyl)-phenyl]-amino}-3-pyridinesulfonic acid
33271-88-4 (η5-2,4-Cyclopentadien-1-yl)-tris-(N-methylmethanaminato)-zirconium
33277-15-5 Ethyl 5-(4-bromophenyl)-isoxazole-3-carboxylate
33278-46-5 4-Pyridinecarboxamidine
33282-16-5 5-(4-Methoxyphenyl)-isoxazole-3-carboxylic acid
33282-21-2 5-p-Tolylisoxazole-3-carboxylic acid
33282-22-3 5-(4-Chlorophenyl)-isoxazole-3-carboxylic acid
33282-23-4 5-(4-Bromophenyl)-isoxazole-3-carboxylic acid
33284-52-5 3,5,3',5'-Tetrachlorobiphenyl
33286-22-5 Diltiazem HCI
33288-71-0 N-{2-[4-(Aminosulfonyl)-phenyl]-ethyl}-5-methylpyrazinecarboxamide
33290-12-9 (S)-(-)-N-(α-Phenethyl)-urethane
33294-55-2 N-[(1,1-Dimethylethoxy)-carbonyl]-L-valine anhydride
33297-48-2 N-Acetyl-S-(2-ethoxycarbonylethyl-1-methyl)-L-cysteine dicyclohexylammonium salt
33305-75-8 L-Proline ethyl ester hydrochloride
33305-77-0 Nα-tert-Butoxycarbonyl-3-(4-nitrophenyl)-L-alanine
33312-93-5 6-(Methyl-d3-mercapto)-purine
33317-65-6 Bis-(3-chloropropyl)-dichlorosilane
33320-16-0 Methyl aminolevulinate
33329-35-0 Tris-(3-dimethylamino)-propylamine
33332-25-1 5-Chloro-2-pyrazinecarboxylic acid methyl ester
33332-29-5 2-Amino-5-chloropyrazine
33334-08-6 1-Amino-1H-indazole
33335-58-9 Dimethyltubocurarinium chloride
33342-17-5 5-(4-Fluorophenyl)-2-furancarboxaldehyde
33342-65-3 2-Chloro-5-methylthiazole
33345-96-9 4-Oxo-2-(1-piperidinyl)-4H-pyrido[1,2-a]-pyrimidine-3-carboxaldehyde
33354-75-5 4',4,4’’-Trimethyl-2,2':6',2''-terpyridine
33369-26-5 3-(Ethoxycarbonyl)-1,4-dimethyl-1H-pyrrole-2-acetic acid ethyl ester
33369-31-2 Zomepirac
33369-45-8 3-Carboxy-1,4-dimethyl-1H-pyrrole-2-acetic acid
33375-06-3 (R)-(+)-(1-Isocyanatoethyl)-benzene
33380-11-9 Ammonium hexafluorotantalate
33384-62-2 1-Benzyl-1-ethylhydrazine
33386-20-8 4-(Aminobutyl)-1-(2-pyrimidinyl)-piperazine
33388-19-1 3-(1-Oxopropyl)-2(3H)-benzoxazolone
33390-42-0 Gartanin
33396-37-1 Meproscillarin
33399-46-1 4-Ethoxypyridine
33400-49-6 2-Amino-6-[(4-fluorobenzyl)-amino]-3-nitropyridine
33401-74-0 Cycloheptanecarboxylic Acid
33401-87-5 PANOSE
33401-94-4 Pyrantel tartrate
33402-03-8 Metaraminol Bitartrate
33402-67-4 Anisaldehyde sodium bisulfite
33403-10-0 Dodecyl potassium phosphate
33406-96-1 2-Chloro-5-fluorotoluene
33410-59-2 Nortriptyline
33419-42-0 Etoposide
33420-52-9 2,4,6-Trichloro-5-Methylpyrimidine
33421-39-5 2-Phenylnicotinic acid
33421-40-8 2-Amino-5-phenylpyridine
33421-53-3 2,3-Diphenylpyridine
33430-61-4 2'-Deoxyguanosine-5'-monophosphoric acid disodium salt
33430-62-5 Thymidine-5'-monophosphoric acid disodium salt
33456-68-7 4-[2-(3,4-Dihydro-7-methoxy-4,4-dimethyl-1,3-dioxo-2(1H)-isoquinolinyl)-ethyl]-benzenesulfonamide
33457-48-6 4,5-Bis-(hydroxymethyl)-2-methylimidazole
33458-26-3 6-Methyl-4-phenyl-2-thioxo-1,2,3,4-tetrahydropyrimidine-5-carboxylic acid ethyl ester
33458-36-5 Ethanethiol-d1
33466-31-8 Dibutyltin bis-(lauryl maleate)
33467-73-1 (Z)-3-Hexen-1-yl formate
33467-74-2 (Z)-3-Hexen-1-yl propionate
33468-35-8 6-Chloro-L-tryptophan
33468-67-6 2-Methyl-4-trifluoromethylimidazole
33468-69-8 4-(Trifluoromethyl)-1H-imidazole
33468-83-6 4-[5-(Trifluoromethyl)-1H-imidazol-2-yl]-pyridine
33469-15-7 2-(4-Chlorophenyl)-4-(trifluoromethyl)-1H-imidazole
33469-18-0 2-p-Tolyl-4-(trifluoromethyl)-1H-imidazole
33469-36-2 2-Pheny-4-(trifluoromethyl)-1H-imidazole
33478-30-7 Adipic acid/1,4-cyclohexanedimethanol copolymer
33490-11-8 4-Oxo-2,2,6,6-tetramethylpiperidine-1-15N-1-oxyl
33491-30-4 8-Bromo-2H-chromen-2-one
33494-11-0 L-Tyrosine butyl ester hydrochloride
33499-42-2 2,4-Dimethylbenzoic acid ethyl ester
33499-43-3 2,5-Dimethylbenzoic acid ethyl ester
33500-15-1 tert-Butyl-1,1,1-d3 alcohol
33507-63-0 Substance P
33515-09-2 Gonadorelin Acetate
33515-32-1 L-Methionine-S-methylsulfonium bromide
33522-03-1 Isothiocyanatocyclopentane
33522-04-2 Isothiocyanatocyclooctane
33537-97-2 6-Chloro-1,2,3,4-tetrahydroisoquinoline hydrochloride
33537-99-4 6-Chloro-1,2,3,4-tetrahydroisoquinoline
33543-78-1 Imidazole-2-carboxylic acid ethyl ester
33548-33-3 1,4,5,6-Tetrahydro-6-oxo-1-phenyl-3-pyridazinecarboxylic acid
33562-89-9 Aromatic Compounds
33564-30-6 Cefonicid sodium
33564-64-6 3-Bromo-2,4,5,6-tetrafluorobenzoic acid
33564-68-0 4-Bromo-2,3,5,6-tetrafluorotoluene
33567-83-8 Bis-(dimethylamino)-methyl-(phenyl)-silane
33570-04-6 CASTICIN
33575-83-6 2-(Chloromethyl)-5-phenyl-1,3,4-oxadiazole
33577-16-1 Methyl methylsulfinylmethyl sulfide
33577-98-9 4-(3-Hydroxy-3-methyl-1-butynyl)-benzoic acid methyl ester
33577-99-0 2-(Methoxycarbonyl)-phenylacetylene
33580-59-5 (3-Methoxypropyl)-trimethoxysilane
33580-79-9 Krypton-78
33581-77-0 Trimethylsiloxyacetic acid trimethylsilyl ester
33581-98-5 Pyrimidin-4-yl-methanol
33584-60-0 2-Amino-2-indanecarboxylic acid hydrochloride
33584-66-6 5'-Nitrospiro[imidazolidine-4,2'-indane]-2,5-dione
33586-66-2 Imazalil nitrate
33588-54-4 5-Bromo-1,3-indoxyl diacetate
33599-61-0 6-Bromo-DL-tryptophan
33605-69-5 Histidylprolineamide
33605-94-6 Pirisudanol
33611-43-7 3-Morpholinopropionic acid methyl ester
33617-59-3 4-(Hydroxymethyl)-resorcinol
33619-78-2 1,5-Dibromo-2,2,3,3,4,4-hexafluoropentane
33621-24-8 {[5-(2-Furanyl)-1,3,4-oxadiazol-2-yl]-thio}-acetic acid
33623-16-4 4-Amino-2-methoxy-3-nitropyridine
33625-43-3 2,5-Dimethyl-4-(4-morpholinylmethyl)-phenol hydrochloride
33625-61-5 3-{4-[(Acetylamino)-sulfonyl]-butyl}-5-cyano-2-[3-(5-cyano-1,3-diethyl-1,3-dihydro-2H-benzimidazol-2-ylidene)-1-propen-1-yl]-1-ethyl-1H-benzimidazolium bromide
33628-03-4 5-Phenyl-2-{2-{[5-phenyl-3-(3-sulfopropyl)-2-benzoxazolinylidene]-methyl}-1-butenyl}-3-(3-sulfopropyl)-benzoxazolium hydroxide inner salt
33628-20-5 3-Ethyl-2-{(E)-2-{3-[(E)-(3-ethyl-1,3-benzothiazol-2(3H)-ylidene)-2-(4-morpholinyl)-1-cyclopenten-1-yl}-ethenyl}-1,3-benzothiazol-3-ium iodide
33629-47-9 Butralin
33630-20-5 4-Methoxy-2-phenylpyrimidine
33630-94-3 5-Amino-2-hydroxypyridine
33630-99-8 3-Amino-2-hydroxypyridine
33631-02-6 3,4-diaminopyridin-2-ol
33631-05-9 2-Amino-4-hydroxypyridine
33631-09-3 3-Amino-4-methoxypyridine
33632-27-8 1-Acetyl-5-nitroindoline
33632-74-5 3,4-(Trimethylenedioxy)-benzoic acid
33636-93-0 Triphenylphosphine copper(I) hydride
33641-15-5 5-Hydroxy-1-methylpyrazole
33643-46-8 (S)-(+)-Ketamine
33643-94-6 4-Hydroxy-2-phenylpyrimidine
33646-31-0 3-Chloro-DL-alanine methyl ester hydrochloride
33659-28-8 Calcium bromolactobionate
33662-58-7 2,4-Dihydroxy-m-toluic acid methyl ester (COOCH3=1)
33663-41-1 2,5-Dichloroaniline hydrochloride
33664-93-6 5,5-Dimethyl-4-phenyloxazolidin-2-one
33665-90-6 Acesulfame-K
33670-32-5 (Methoxymethyl)-triphenylphosphonium bromide
33671-46-4 Clotiazepam
33673-62-0 Dihydro-4-methyl-5-pentylfuran-2(3)-one
33674-96-3 2-Bromo-6-(hydroxymethyl)-pyridine
33675-83-1 Acetamide-d5
33677-56-4 Bis-(dibenzylideneacetone) platinum
33682-78-9 1-Ethyl-6-methyl-2(1H)-quinolinethione
33685-54-0 1,1,2,2-TETRACHLOROETHANE-D2
33693-04-8 Terbumeton
33693-84-4 Phthalic acid mono-tert-butyl ester
33697-81-3 3-Chloro-4-hydroxybenzeneacetic acid
33701-74-5 Hexafluoro-2-propylalcohol-d2
33703-08-1 Diisononyl adipate
33704-61-9 6,7-Dihydro-1,1,2,3,3-pentamethyl-4(5H)-indanone
33712-34-4 Benzyl-α,α-d2 chloride
33719-74-3 3,5-Dichloroanisole
33725-74-5 Tetrabutylammonium Borohydride
33733-73-2 M-Bromothioanisole (MBTA)
33738-48-6 4-Methyl-1-naphthaldehyde
33739-04-7 5,6,7,8-Tetrafluorocoumarin
33744-19-3 2-Propylisonicotinonitrile
33754-49-3 Zolazepam hydrochloride
33755-53-2 D-Biotin 4-nitrophenyl ester
33757-48-1 8-(Benzoylamino)-quinoline
33763-20-1 4-Methyl-2-phenyl-5-thiazolecarboxylic acid
33765-68-3 Oxendolone (JAN/USAN)
33769-07-2 1-Tritylimidazole-4-methanol
33770-60-4 Mercuric chloranilate
33774-52-6 Detajmium bitartrate
33797-51-2 N,N-Dimethylmethyleneammonium iodide
33817-09-3 (R)-(-)-Deoxyephedrine
33818-15-4 Citicoline sodium
33818-85-4 Citicoline Monosodium Salt
33820-53-0 ISOPROPALIN
33823-18-6 8-Methylaminoadenosine-3',5'-cyclic monophosphoric acid sodium salt
33830-10-3 1-Aminoadamantane-d15
33830-12-5 1-Adamantane-d15-carboxylic acid
33838-52-7 Heptane-d16
33842-02-3 (dichloromethylene)dimethylammonium chloride
33844-21-2 4-Hydroxy-2-nitrobenzoic acid methyl ether
33858-36-5 2,6-Di(benzo(d)oxazol-2-yl)-pyridine
33860-28-5 N-Methyl-N'-piperazinecarbothioamide
33861-17-5 Trimethyl-(phenylseleno)-silane
33863-76-2 3-Bromo-5-chlorofluorobenzene
33863-86-4 4-Butoxybenzoyl chloride
33866-48-7 3-(4-Chlorophenyl)-1,2-oxazol-5-amine
33875-38-6 (R)-(-)-2-Amino-2-phenylbutyric acid
33876-97-0 Linsidomine
33879-04-8 (3aS,7aS)-(+)-Hexahydro-3a-hydroxy-7a-methyl-1,5-indanedione
33885-51-7 6,6-dimethylbicyclo[3.1.1]hept-2-ene-2-propionaldehyde
33889-68-8 Demethyl tetrandrine
33892-75-0 5-Methoxy-1-tetralone
33893-89-9 5-(2-Pyridyl)-1H-tetrazole
33898-60-1 5-Phenyl-2-[2-[[5-phenyl-3-(2-sulfoethyl)-2-benzoxazolinylidene]-methyl]-1-butenyl]-3-(2-sulfoethyl)-benzoxazolium hydroxide inner salt triethylamine
33900-28-6 Nα-tert-Butoxycarbonyl-L-tryptophan methyl ester
33901-36-9 5-(4-Methoxyphenyl)-4H-1,2,4-triazole-3-thiol
33904-03-9 2,4-Dimethoxyisothiocyanatobenzene
33904-04-0 3,4-Dimethoxyisothiocyanatobenzene
33907-46-9 Ethyleneglycol mono-12-hydroxystearate
33912-24-2 2-Tridecylpyridine
33922-80-4 1,1'-Thiobis-1-propene
33924-48-0 5-Chloro-o-anisic acid methyl ester (COOCH3=1)
33924-76-4 Carbonic acid, heptyl ester, ester with p-ethoxyphenyl p-hydroxybenzoate
33927-05-8 3,5-Dinitro-4-hydroxybenzoic acid methyl ester
33939-64-9 Polyethyleneglycol carboxymethyl lauryl ether sodium salt
33940-98-6 Triglyceryl monooleate
33940-99-7 Decaglyceryl dioleate
33941-15-0 Aza-18-crown-6
33941-99-0 2-Methyl-4-phenyl-1,3-dioxolane
33942-96-0 4-Chloro-3-[2-(4-methoxydibenzoyl)-acetylamino]-benzoic acid dodecyl ester
33944-90-0 2,2'-Selenobis-(L-τ-glutamyl-L-cysteinylglycine)
33945-50-5 Diacetamide-d7
33951-33-6 1-Bromo-2-(methylsulfonyl)-benzene
33953-37-6 4-Benzamidopiperidine
33955-17-8 N-(2-Thienylcarbonyl)-glycine
33956-49-9 (E,E)-8,10-Dodecadien-1-ol
33959-50-1 Zinc tetrakis(acetato-O)dioxouranate
33963-55-2 2-(Methylsulfonyl)-benzoic acid
33963-58-5 4-(Methylsulfinyl)-benzoic acid
33965-42-3 N-Acetyl-L-Citrulline
33965-47-8 3-(4-Chlorophenyl)-D-alanine methyl ester hydrochloride
33973-59-0 2,2,6,6-Tetramethyl-4-piperidinone hydrochloride
33975-46-1 Nonyl-6,6,7,7-d4 alcohol
33976-43-1 4-(Anilino)-trimethoxysilane
33977-11-6 5-Chloro-2-methoxybenzoic acid hydrazide
33979-03-2 2,2',4,4',6,6'-Hexachlorobiphenyl
33983-40-3 MEDICARPIN
33984-05-3 Acrolein-d4
33984-50-8 MBD
33985-71-6 9-Julolidinecarboxaldehyde
33986-51-3 SHS
33987-24-5 Propylthiouracil N-β-D-glucuronide
33989-10-5 (1,10-Phenanthroline)-bis-(triphenylphosphine) copper (I) nitrate dichloromethane adduct
33993-25-8 2-Naphthyl-β-D-galactopyranoside
33996-30-4 trans-4-Hydroxy-L-proline ethyl ester hydrochloride
33996-33-7 Oxaceprol
33996-58-6 Etiracetam
33998-26-4 Cholesteryl phenylacetate
34000-39-0 HOMOBUTEIN
34004-14-3 Methyl α-D-galactopyranoside
34006-32-1 Hexanedinitrile-d8
34006-49-0 2-Chloro-4'-nitroacetophenone
34009-61-5 Methylphenylmalonic acid diethyl ester
34014-18-1 Tebuthiuron
34014-51-2 1-Oxo-2H-isoquinoline-4-carboxylic acid
34017-27-1 S-Methyl-L-cysteine methyl ester hydrochloride
34017-39-5 4-(3-Aminoanilino)-2,5,6-trichloropyrimidine
34018-28-5 Lead bromate
34023-49-9 4-Sulfonic acid L-phenylalanine
34031-32-8 Auranofin
34033-44-8 2,4-Dichloro-5-nitroaniline
34036-07-2 3,4-Difluorobenzaldehyde
34036-80-1 Tris-(methylethylketoxime)-phenylsilane
34037-21-3 2,5-Morpholinedione
34040-62-5 2-(Chloromethyl)-benzoic acid methyl ester
34040-63-6 3-(Chloromethyl)-benzoic acid methyl ester
34040-64-7 4-(Chloromethyl)-benzoic acid methyl ester
34041-09-3 Molybdenum 2-ethylhexanoate
34042-85-8 Sudoxicam
34045-29-9 3-Aminopyrazole hydrochloride
34046-43-0 Ethyl phthalaldehydate
34050-00-5 Methyl Ester L-Lysine Diisocyanate
34051-30-4 N6-Phenyladenosine-3',5'-cyclic monophosphoric acid sodium salt
34052-37-4 2-Chloro-5-nitrobenzophenone
34052-90-9 1,3-Phenylene- bis-oxazoline
34064-86-3 N-(2-Cyanoethyl)-piperazine
34068-01-4 3'-(Benzyloxy)-acetophenone
34069-57-3 4-Amino-2-fluorobutyric acid
34071-94-8 Quinoline-d7
34071-95-9 1-[3-(4-Hydroxyphenyl)-1-oxopropoxy]-2,5-pyrrolidinedione
34078-85-8 Nα-Benzyloxycarbonyl-L-glutamine N-hydroxysuccinimide ester
34079-68-0 2,6-Diaminopurinearabinoside
34081-17-9 L-Tyrosine ethyl ester HCL
34089-81-1 Ferric sodium gluconate
34090-76-1 Tetrahydro-5-methyl-1,3-isobenzofurandione
34097-37-5 2,6-Diacetamidopurine
34097-60-4 Methyl phenylsulfonylacetate
34098-18-5 5-Chloroprotocatechualdehyde
34099-69-9 7-Chloro-5-phenyl-2-thioxo-2,3-dihydro-1H-1,4-benzodiazepine
34101-86-5 3,3',4,4'-Tetramethylbibenzyl
34107-46-5 5-(Hydroxymethyl)-α-picoline
34108-95-7 1,3-Dihydro-2H-naphth[1,2-d]imidazole-2-thione
34109-80-3 Nickel hexafluorotitanate
34113-69-4 4-Chloro-3-hydroxybenzoic acid
34114-12-0 4-(1H-Tetrazol-5-yl)-benzoic acid
34117-90-3 2-Amino-3-chloroquinoxaline
34118-92-8 Acecainide hydrochloride
34123-59-6 Isoproturon
34123-66-5 3-Isopropoxy-p-anisaldehyde (CHO=1)
34124-14-6 EDTA
34126-16-4 4-Bromo-3,5-dihydroxybenzoic acid methyl ester
34126-43-7 1-(Ethylthio)-3-nitrobenzene
34127-96-3 3-Butoxy-4-methoxybenzaldehyde
34131-98-1 6-Isopropyl-2(1H)-octahydronaphthalenone
34135-85-8 Methyl Allyl Trisulfide
34136-59-9 2-Ethylbenzonitrile
34137-09-2 3,5-Di-tert-butyl-4-hydroxyhydrocinnamic acid 1,3,5-tris-(2-hydroxyethyl)-sym-triazine-2,4,6-(1H,3H,5H)-trione ester
34145-05-6 2,5-Dichlorobenzyl alcohol
34148-01-1 Clidanac
34148-38-4 3-(Aminomethyl)-pyridine salicylate
34152-86-8 Z-Gly-Gly-Val-OH
34156-56-4 Foscarnet Sodium
34156-69-9 Manganous carbonate
34157-83-0 Celastrol
34160-40-2 6-Bromo-2-pyridinecarboxaldehyde
34161-24-5 Fipexide
34171-69-2 Potassium tricyanomethanide
34172-21-9 4,4'-Azoxyanisole-d6 (O,O-dimethyl-d6)
34177-11-2 3-Chloro-5,6-diphenyl-1,2,4-triazine
34184-41-3 4-Chlorobenzenesulfonic acid octadecyl ester
34184-77-5 Promegestone
34193-38-9 1-Butanol-d10
34199-87-6 2-Bromo-6-(1,3-dioxolan-2-yl)-pyridine
34202-69-2 1,1,1,3,3,3-Hexafluoro-2-propano
34205-21-5 Dimefuron
34206-40-1 Tetra(methylethylketoxime)silane
34206-49-0 5-Bromo-2,3-dihydroxypyridine
34207-44-8 3,5-Diamino-4-chlorobenzotrifluoride
34209-81-9 16,17-Epoxypregnenolone acetate
34212-83-4 Glutathione sodium, reduced
34213-34-8 Methyl-β-D-glucopyranosiduronic acid methyl ester 2,3,4-triacetate
34213-86-0 4-Aminophenyl α-D-mannopyranoside
34215-57-1 DIO
34217-64-6 Tributylmethylphosphonium
34218-76-3 Homoglutamine
34225-81-5 3-Methyl-1H-indene-2-carboxylic acid
34231-77-1 Methyl pyridazine-4-carboxylate
34231-78-2 3-Acetoxybenzaldehyde
34244-14-9 1-Chloropyrene
34252-44-3 2-Methyl-2H-indazole-3-carboxylic acid
34253-01-5 5-Pyrimidinecarboxylic acid methyl ester
34253-03-7 Methyl 2- pyrimidine carboxylate
34256-82-1 Acetochlor
34257-63-1 (N-Methylphenylamino)-triphenylphosphonium iodide
34258-14-5 N-Glycyl-D-α-phenylalanine
34259-99-9 4-Bromothiazole
34260-70-3 DL-m-Tyrosine methyl ester hydrochloride
34262-84-5 Mesocarb
34270-33-2 N-(Carboxymethyl)-N-[(2-hydroxyphenyl)-methyl]-glycine disodium salt
34271-27-7 Boc-Asp(OcHex)-OH
34271-54-0 L-Theanine
34272-64-5 MTAA
34272-65-6 2,4-Dimethyl-5-thiazoleacetic acid
34272-83-8 3-Amino-2,2,5,5-tetramethyl-1-pyrrolidinyloxy
34273-01-3 4,4-Diphenylpiperidine
34273-10-4 SARALASIN
34281-22-6 Ethylenediamine-d8
34284-87-2 6-(Methylamino)-uracil
34285-88-6 2-[[3-(3-Hydroxypropyl)-5-oxo-1-phenyl-2-thioxo-4-imidazolidinylidene]-ethylidene]-3-(2-H)-benzoxazolepropanoic acid
34289-60-6 4,6-Dimethyl-2-hydroxypyrimidine hydrochloride
34291-02-6 Busulfan
34291-99-1 4-Isopropylhydratropicaldehyde
34295-45-9 4-[(4-Diethylaminophenyl)-azo]-aniline
34296-51-0 1-Phenyl-1H-1,2,3-triazole-4-carbaldehyde
34298-75-4 Hex-4-yn-1-ylbenzene
34301-55-8 Isometamidium chloride
34306-42-8 N-tert-Butoxycarbonyl-L-2-aminobutyric acid
34316-64-8 Hexyl laurate
34317-61-8 D-S-phenylcysteine
34322-06-0 Isopropyl thioisovalerate
34322-09-3 sec-Butyl-3-methyl -2-butenethioate
34328-00-2 2-[2-[3-(2-Hydroxyethyl)-5-oxo-1-phenyl-2-thioxo-4-imidazolinylidene]-ethylidene]-3-benzoxazolinepropanesulfonic acid monosodium salt
34328-46-6 4-Chloro-3-(trifluoromethyl)-benzaldehyde
34328-47-7 4-Bromo-3-(trifluoromethyl)-benzaldehyde
34328-61-5 3-Chloro-4-fluorobenzaldehyde
34330-20-6 5-(1-Methyl-2(1H)-pyridinylidene)-4-oxo-2-thioxo-3-thiazolidineacetic acid
34334-28-6 4-(4-Methylpiperazin-1-yl)-benzonitrile
34334-71-9 Ethylene-d4-diamine dihydrochloride
34334-96-8 5-Methyl-3-nitro-1H-pyrazole
34338-96-0 (2S,5S)-(+)-2,5-Hexanediol
34345-47-6 Poly-L-aspartic acid sodium salt
34352-74-4 2-(4-Biphenylyl)-2-propanol
34364-20-0 Yttrium ethoxide
34364-24-4 Isostearyl benzoate
34365-79-2 Isopropyl 3-methylthio-2-butenoate
34368-04-2 Dobutamine
34368-52-0 (3S)-3-Hydroxypyrrolidin-2-one
34369-07-8 Adenosine 5′-triphosphate disodium salt
34372-72-0 GREEN D-N
34373-96-1 9,10-Bis-(bromomethyl)-anthracene
34374-67-9 5,6-Dichlorobenzotriazole
34376-54-0 Homopiperazin-5-one
34381-68-5 Acebutolol Hydrochloride
34381-71-0 N-Methyl-L-prolinol
34384-79-7 Allyl b-D-glucopyranoside
34385-94-9 5-Chloro-2,3-dihydro-1-benzofuran-2-carboxylic acid
34388-29-9 METHOTHRIN
34391-04-3 R-Salbutamol
34396-03-7 I-octyltrimethoxysilane
34398-01-1 Polyethyleneglycol undecyl ether
34402-78-3 Methyl 4-methylpyrrole-2-carboxylate
34404-28-9 N-tert-Butoxycarbonyl-D-glutamic acid
34404-30-3 N-tert-Butoxycarbonyl-D-glutamic acid 2-benzyl ester
34404-32-5 Nε-Benzyloxycarbonyl-D-lysine
34404-33-6 N-tert-Butoxycarbonyl-D-alanine N-hydroxysuccinimide ester
34404-36-9 Nε-Benzyloxycarbonyl-Nα-tert-butoxycarbonyl-L-lysine N-hydroxysuccinimide ester
34406-66-1 Decaglyceryl monolaurate
34408-14-5 8-Chloroadenosine
34413-35-9 5,6,7,8-Tetrahydroquinoxaline
34421-94-8 4-Bromobenzaldehyde diethyl acetal
34424-97-0 Hexaglyceryl distearate
34424-98-1 Decaglyceryl tetraoleate
34425-86-0 2-[(4-Methoxybenzoyl)-amino]-benzoic acid
34425-87-1 2-[(4-Chlorobenzoyl)-amino]-benzoic acid
34430-82-5 Chromic chloride methacrylate
34444-37-6 (-)-Nortrachelogenin
34445-07-3 Silver diammine fluoride
34447-09-1 4-[1-(Aminophenyl)-cyclohexyl]-aniline
34451-19-9 Butyl L-Lactate
34452-51-2 Mercaptoacetic acid potassium salt
34461-00-2 Nitromalonaldehyde sodium
34464-40-9 Isononane
34481-48-6 Polyvinyl acetate phthalate
34482-99-0 Fletazepam
34486-24-3 2-Amino-6-(trifluoromethyl)-pyridine
34491-29-7 2-(4-Chlorophenyl)-thiazolidine-4-carboxylic acid
34493-98-6 Dibekacin
34500-31-7 L-Luciferin
34503-11-2 Polyethyleneglycol sulfate sodium salt
34513-50-3 Octyldodecanol
34513-98-9 Ruthenium nitrosyl nitrate
34521-09-0 Antimony sodium tartrate
34523-31-4 N-(4-Hydroxyphenyl)-N-methylbenzenesulfonamide
34523-34-7 4'-Hydroxyacetophenone oxime
34540-22-2 Madecassoside
34541-73-6 trans-4,4'-Stilbenedicarboxylic acid dimethyl ester
34545-88-5 4,4a,5,6-tetrahydro-7-methylnaphthalene-2(3H)-one
34552-13-1 5-Amino-6-chloro-β-picoline
34552-14-2 5-Amino-6-bromo-β-picoline
34552-15-3 2-Chloro-3-fluoro-5-picoline
34552-16-4 2-Bromo-3-fluoro-5-methylpyridine
34552-83-5 Loperamide hydrochloride
34552-84-6 Isoxicam
34560-16-2 Nitroacetaldehyde diethyl acetal
34562-31-7 3,5-Diethyl-1,2-dihydro-1-phenyl-2-propyl-pyridine
34562-97-5 Pikamilone
34566-04-6 (S)-2-Aminooctane
34566-05-7 (R)-2-Aminooctane
34570-17-7 Malonamidine hydrochloride
34576-83-5 3-Chloro-6-fluoro-1-benzothiophene-2-carbonyl chloride
34576-87-9 3-Chloro-6-methylbenzothiophene-2-carbonyl chloride
34576-89-1 3,7-Dichloro-6-methoxybenzo[b]thiophene-2-carboxylic acid
34576-90-4 3,4,6-Trichlorobenzo[b]-3-thiophenecarboxylic acid
34576-92-6 3-Chloro-6-fluorobenzo[b]thiophene-2-carboxylic acid
34576-94-8 3,6-Dichlorobenzo[b]thiophene-2-carboxylic acid
34576-96-0 3-Chloro-6-methylbenzothiophene-2-carboxylic acid
34580-13-7 Ketotifen (base and/or unspecified salts)
34580-14-8 Ketotifen fumarate
34582-32-6 N-Boc-L-aspartic acid alpha-tert-butyl ester
34582-65-5 D-α-Phenylglycine dane salt potassium methyl
34583-34-1 (S)-(+)-3-Hydroxyquinuclidine
34584-69-5 3,6-Dichloro-4,5-dimethylpyridazine
34590-94-8 Methoxypropoxypropanol
34592-47-7 L-Thioproline
34595-26-1 2-(1-Piperidinyl)-benzaldehyde
34595-91-0 2-Bromo-3,5,6-trimethylpyridine
34598-49-7 5-Bromo-1-indanone
34601-54-2 1,3,6,8-Tetrakis-(tert-butyl)-9H-carbazole
34604-60-9 4,5-Dihydro-5-oxopyrazinecarboxylic acid
34612-38-9 Maltotetraose
34612-80-1 L-Aspartic acid N,N-diacetic acid tetrasodium salt
34616-39-2 Fenalcomine
34619-32-4 1,2-DICHLORODECANE
34622-08-7 Trifluoromethanesulfonic acid neodymium salt
34622-39-4 (S)-2-Piperidinone-6-carboxylic acid
34622-58-7 ORBENCARB
34629-21-5 Trifluoromethanesulfonic acid lanthanum salt
34632-69-4 Ethyl 4-chloro-2-quinazolinecarboxylate
34633-34-6 Bifluranol
34633-69-7 1-Chloro-2,5-dimethyl-4-nitrobenzene
34636-92-5 2-Methoxy-5-(trifluoromethyl)-benzonitrile
34637-41-7 4-Chloro-2-chloromethylquinazoline
34638-25-0 (±)-τ-Lactone
34642-77-8 Sodium Amoxicillin
34643-39-5 3,4,5,6-Tetrachloro-2-cyanobenzoic acid ammonium salt
34643-46-4 O-(2,4-Dichlorophenyl)-O-ethyl-S-propyl dithiophosphate
34644-00-3 (R)-(+)-Pantetheine-S-sulfonic acid calcium salt
34645-84-6 Fenclofenac
34648-11-8 5-Trichloromethyl-4,5-dihydro-isoxazol-5-ol
34648-99-2 4-Chloro-5-nitro-o-toluidine (NH2=1)
34658-66-7 2-(4-Bromophenyl)-imidazo[1,2-a]pyridine
34661-75-1 URAPIDIL
34662-31-2 5-Chloro-2-nitrobenzonitrile
34662-32-3 4-Chloro-2-nitrobenzonitrile
34662-59-4 8-Methyl-4-oxo-4H-pyrido[1,2-a]-3-pyrimidinecarboxylic acid
34670-04-7 4-(4-Ethylbenzoyl)-butyric acid
34671-83-5 2,2'-Bipyrimidine
34675-84-8 Cetraxate
34681-10-2 Butocarboxim
34681-23-7 Butoxycarboxim
34683-40-4 Pyrazolo[1,5-a]-1,3,5-triazine-2,4(1H,3H)-dione
34683-73-3 1-Chloro-6-iodohexane
34688-71-6 Mesitylacetonitrile
34689-96-8 Lithium 2-ethylhexoxide
34690-00-1 Bishexamethylenetriamine, pentamethylenepentaphosphonic acid
34695-46-0 Nα-tert-Butoxycarbonyl-Nε-trifluoroacetyl-L-lysine N-hydroxysuccinimide ester
34698-41-4 1-Aminoindane
34701-14-9 4-Nitroindane
34702-59-5 L-Pentafluoro-phe-OH
34702-60-8 Nα-tert-Butoxycarbonylpentafluorophenyl-L-alanine
34708-08-2 (3-Thiocyanatopropyl)-triethoxysilane
34714-00-6 6-Chloro-1-trimethylsilyloxyhexane
34717-03-8 Magnesium Orotate (Dihydrate)
34717-22-1 Succinic acid monopotassium salt
34719-10-3 2-{{5-(Aminocarbonyl)-3-[(3-ethyl-1,3-benzothiazol-2(3H)-ylidene)-methyl]-2-cyclohexen-1-ylidene}-methyl}-3-ethyl-1,3-benzothiazol-3-ium iodide
34722-01-5 3-Butylthiophene
34722-90-2 Bromothymol Blue, Sodium Salt
34725-61-6 Bromophenol Blue, Water Soluble, Reagent
34730-20-6 2-Acetyl-4-chlorothiophene
34737-89-8 1-Benzyl-3-methyl-4-piperidone
34743-87-8 Phenoxyethyl chloroformate
34743-88-9 2-(4-Bromophenoxy)-ethanol
34749-75-2 Acridine-d9
34756-16-6 5-Methyl-2-furanpropionaldehyde
34758-83-3 Zipeprol
34767-55-0 Acetylacetonatobis-(cyclooctene)-rhodium (I)
34769-44-3 Usnic acid sodium salt
34772-90-2 Bromothymolbluesodiumsalt
34781-86-7 4-Aminoresorcinol hydrochloride
34784-02-6 3-Bromoisoquinoline
34784-04-8 5-Bromoisoquinoline
34784-05-9 6-Bromoisoquinoline
34784-07-1 8-Chloro-isoquinoline
34784-64-0 Tertatolol
34785-11-0 4-Hydroxy-3-quinolinecarboxylic acid
34798-80-6 4-Acetyl-4-phenylpiperidine
34801-14-4 4-(5-Bromothiophen-2-yl)-1,3-thiazol-2-amine
34803-66-2 1-(2-Pyridyl)-piperazine
34805-17-9 O-Benzyl-L-tyrosine methyl ester hydrochloride
34805-19-1 Amino Acid Derivatives
34805-21-5 Nα-tert-Butoxycarbonyl-L-methionine sulfoxide
34806-73-0 Zirconium sulfate (4+)
34810-13-4 9-Anthraldehyde oxime
34810-67-8 2-(1H-Pyrazol-3-yl)-phenol
34816-23-4 Sucrose octaoleate
34819-86-8 3,4-Di-O-acetyl-L-rhamnal
34824-58-3 2-(2-Bromophenyl)-1,3-dioxolane
34825-70-2 1-Amino-5-hexene
34825-99-5 2-(Diphenylphosphino)-benzonitrile
34840-23-8 1,3-Bis-(methoxycarbonyl)-2-methylisothiourea
34841-06-0 3-Bromo-p-anisaldehyde
34841-35-5 3'-Chloropropiophenone
34841-36-6 Bupropion Hydrochloride
34841-39-9 Bupropion Hydrochloride
34844-03-6 1-Chloro-2-methoxyethylene
34846-44-1 3-(Bromomethyl)-thiophene
34846-64-5 3-Cyanoquinoline
34846-65-6 Isoquinoline-4-carbonitrile
34850-66-3 Sodium DL-camphorsulfonate
34853-57-1 N,N'-Dioctyl-2-thiourea
34859-64-8 5-Amino-4-isoxazolecarboxylic acid ethyl ester
34866-47-2 Carbuterol
34869-32-4 2,3,4,6-Tetraiodobenzoic acid butyl ester
34876-18-1 Caprolactam
34879-34-0 5-Amino-4-imidazolecarboxamide ureidosuccinate
34883-41-5 3,5-Dichlorobiphenyl
34883-43-7 2,4'-Dichlorobiphenyl
34884-10-1 N-Methyl-2-pyrrolecarbonitrile
34885-02-4 N-(3-Aminopropyl)-piperazine
34887-09-7 1-Chloro-3,3-dimethylpentane
34888-05-6 (Trichloromethoxy)-benzene
34892-17-6 Niclosamide piperazine
34893-92-0 3,5-Dichlorophenyl isocyanate
34896-80-5 1-Bromo-3-(methylsulfonyl)-benzene
34897-61-5 N-Benzyloxycarbonyl-L-glutamic acid α-tert-butyl ester dicyclohexylamine salt
34900-01-1 trans-3-Amino-N-methyl-N-phenylacrolein
34901-14-9 Polyethyleneglycol bis-(3-aminopropyl)-ether
34902-57-3 Oxacyclohexadecen-2-one
34911-55-2 Bupropion
34914-39-1 Ritiometane
34915-68-9 Bunitrolol
34919-98-7 Cetamolol
34937-00-3 3-(N-Styrylmethyl-2-aminoethylamino)-propyltrimethoxysilane hydrochloride
34941-21-4 2,2-Dimethyltetrahydro-2H-pyran-4-carbaldehyde
34941-90-7 2,4-Difluoropyridine
34941-91-8 2-Chloro-4-fluoropyridine
34941-92-9 4-Chloro-2-fluoropyridine
34946-82-2 Trifluoromethanesulfonic acid cupric salt
34950-04-4 (4-Methylphenyl)-(pyridin-3-yl)-methanone
34950-82-8 7-Bromo-2H,3H,4H-pyrido[3,2-b][1,4]oxazine
34956-31-5 4'-Acetamido-2'-methylacetophenone
34964-55-1 2,3-Dimethoxy-(isothiocyanatomethyl)-benzene
34966-41-1 Cartazolate
34967-24-3 3,5-Dimethoxybenzylamine
34972-22-0 2-Amino-3-methylquinoxaline
34973-08-5 Porcine Luteinizing Hormone Injection Grade
34981-11-8 3,5-Dinitro-2,6-pyridinediamine
34981-38-9 4-Chloro-2-toluenesulfonyl chloride
34983-48-7 2-(Methylthio)-adenosine 5'-(trihydrogendiphosphate)
34996-91-3 N-Benzoyl-DL-tyrosine
34997-17-6 2,2'-Iminobis[benzothiazole]
35000-37-4 tert-Butoxycarbonylmethyltriphenylphosphonium choride
35000-38-5 Tert-Butyl(triphenylphosphoranylidene)acetate
35010-32-3 4,5-Bis-(trifluoromethyl)-2-nitroaniline
35013-72-0 Biotin-OSu
35018-15-6 2,2-Dimethylpyrrolidine
35021-70-6 (Hexadecyloxy)-benzene
35023-55-3 N-Methyl-L-alanine methyl ester
35034-22-1 2-Methylimidazole-5-carboxaldehyde
35035-05-3 Timepidium bromide
35037-73-1 4-Isocyanatotrifluoromethoxybenzene
35041-11-3 Timonacic sodium
35044-57-6 2,6,6-Trimethyl-2,4-cyclohexadiene-1-carboxylic acid ethyl ester
35044-59-8 Ethyl β-safranate
35045-72-8 L-Valine-d8
35047-29-1 α-2-Pyridylpyridine-2-methanol
35050-10-3 4-Methyl-2-undecylimidazole
35061-61-1 2-Ethylhexyl isobutyrate
35065-24-8 3,7-Dihydroxydibenzofuran
35065-28-2 2,2',3,4,4',5'-HEXACHLOROBIPHENYL
35065-29-3 2,2',3,4,4',5,5'-Heptachlorobiphenyl
35065-30-6 2,2',3,3',4,4',5-HEPTACHLOROBIPHENYL
35071-17-1 2-Mercapto-4-methylpyrimidine
35074-77-2 3,5-Bis-(1,1-dimethylethyl)-4-hydroxybenzenepropanoic acid 1,6-hexanediyl ester
35076-92-7 1,4-dibromocyclohexane
35081-79-9 4-(4-Pyridinethioacetyl)-morpholine
35081-84-6 N,N'-dioctadecylsebacamide
35085-65-5 (±)-p-Hydroxynorephedrine hydrochloride
35086-59-0 3',5'-Diacetoxyacetophenone
35086-82-9 2-Chlorocinnamic acid chloride
35087-77-5 PotassiumD-gluconate
35092-89-8 4-(Carbomethoxy)-3-nitrobenzoic acid
35094-45-2 Adenosine 5'-O-(2-thiodiphosphoric acid)
35094-46-3 Adenosine 5'-O-(3-thiotriphosphoric acid)
35094-87-2 2,4,5-Trihydroxybenzaldehyde
35100-44-8 Endrisone
35103-79-8 Cesium Hydroxide
35109-88-7 2-Iodoadenosine
35112-27-7 2,5-Dichlorobenzoic acid ethyl ester
35112-53-9 Barium thiosulfate
35115-60-7 Teprotide
35120-10-6 (Methylthio)-acetonitrile
35121-78-9 Epoprostenol
35127-50-5 Isooctyl aldehyde
35130-97-3 Tropine 3-mesylate
35134-07-7 3-Methoxy-2-thiophenecarboxaldehyde
35135-01-4 Benafentrine
35138-22-8 Bis-(1,5-cyclooctadiene)-rhodium tetrafluoroborate
35138-23-9 Bis-(1,5-cyclooctadiene)-iridium(I) tetrafluoroborate
35139-67-4 4-Chloro-2,6-diaminopyrimidine N-oxide
35144-22-0 4,6-Dimethyl-2-(methylsulfonyl)-pyrimidine
35146-32-8 N-im-Trityl-L-histidine
35150-06-2 N-tert-Butoxycarbonyl-L-phenylalanineamide
35150-08-4 N-tert-Butoxycarbonyl-L-valine amide
35154-45-1 (Z)-3-Hexen-1-yl isovalerate
35158-25-9 2-Isopropyl-5-methyl-2-hexenal
35160-10-2 2-Amino-4,5-dihydro-N-(2-methylphenyl)-thiazole
35160-95-3 (2-Naphthylmethyl)-triphenylphosphonium bromide
35161-71-8 N-Methyl-2-propyn-1-amine
35164-40-0 Adipic acid-diethyleneglycol-isophthalic acid copolymer
35166-33-7 (5-Methyl-1,2-oxazol-3-yl)-methanol
35166-37-1 3-(Chloromethyl)-5-methylisoxazole
35170-30-0 Adenosine-5'-diphosphoric acid potassium salt
35171-26-7 2,4-Bis-(5,6-diphenyl-1,2,4-triazin-3-yl)-pyridine
35171-64-3 Tetraphenylphosphonium thiocyanate
35179-98-7 Chloromethyl Cyclohexyl Carbonate
35180-01-9 Chloromethyl Isopropyl Carbonate
35180-14-4 N-Benzylisoindoline
35181-24-9 2-(4-Bromophenyl)-6-methoxy-4-quinolinecarboxylic acid
35186-99-3 H-TIC-OH
35192-44-0 1,8-Divinylhexadecafluorooctane
35193-18-1 H-Lys-Tyr-Lys acetate salt
35193-63-6 1,1'-Binaphthyl-2,2'-diyl hydrogenphosphate
35199-18-9 4-(Chloromethyl)-2-(4-methylphenyl)-1,3-thiazole
35202-54-1 1-Cyano-4,5-dimethoxybenzocyclobutene
35203-44-2 1-Propylimidazole
35205-54-0 1-Phenoxyisopropylamine
35206-51-0 2-Butenoic acid 1,3-dimethylbutyl ester
35212-22-7 Ipriflavone
35213-00-4 2,6-Dinitrobenzonitrile
35213-85-5 5-Methyltetrazolo[1,5-a]quinoline
35216-08-1 4'-(2-Furyl)-acetophenone
35219-13-7 4-(1,3,4-Oxadiazol-2-yl)-aniline
35221-12-6 1,3-Diphenyl-2-thiobarbituric acid
35223-80-4 Propyl bromoacetate
35225-79-7 Dibenzylideneacetone
35230-14-9 Stearyl lactate
35231-44-8 4-(Bromomethyl)-7-methoxycoumarin
35233-69-3 Methyl methacrylate-d8
35237-37-7 DL-dodecyline
35239-30-6 (Chloro)-dimethyl-(p-tolyl)-silane
35243-43-7 2-Ethoxy-3-ethylpyrazine
35249-89-9 Ammonium hydroxyacetate
35250-53-4 (2-Mercaptoethyl)-pyrazine
35254-34-3 Lead Fluoroborate
35255-58-4 (chloromethyl)naphthalene
35256-82-7 4-Chloro-3'-methylbenzophenone
35256-85-0 N-Benzyl-N-isopropyl-2,2-dimethylpropionamide
35261-06-4 5-Amino-3-methyl-4-isoxazolecarboxamide
35264-07-4 N-tert-Butoxycarbonyl-L-alloisoleucine
35264-09-6 Boc-cycloleucine
35270-09-8 Sodium acid metaphosphate
35272-15-2 2-Methyl-1,3-thiazole-4-carboxylic acid
35272-19-6 3-Methyl-5-nitrobenzoisothiazole
35274-05-6 Palmityl lactate
35276-83-6 2-Cyano-3'-methoxyacetophenone
35277-02-2 4-Fluoro-1H-pyrazole
35280-78-5 4-{[4-(Hexyloxy)-benzylidene]-amino}-benzonitrile
35285-68-8 Sodium ethyl p-hydroxybenzoate
35285-69-9 Sodium Propylparaben
35292-54-7 1-(4-Methoxyphenyl)-1-methylhydrazine
35293-35-7 Neophylmagnesium Chloride, Solution in THF
35294-37-2 4'-(2-Thienyl)-acetophenone
35295-35-3 3-(1,1,2,2-Tetrafluoroethoxy)-benzaldehyde
35295-36-4 4-(1,1,2,2-Tetrafluoroethoxy)-benzaldehyde
35296-72-1 Butanol
35298-48-7 2,5-DIMETHYL-3(2H)-FURANONE
35302-70-6 Pinosylvin monomethyl ether
35302-72-8 2-(Trichloroacetyl)-pyrrole
35303-76-5 4-(2-Aminoethyl)-benzenesulfonamide
35305-74-9 N-Acetyl-L-glutamine
35306-33-3 Gelsemine hydrochloride
35308-00-0 9-Hydroxy-4-methoxyacridine
35308-68-0 2-Methyl-1,5,6,7-tetrahydro-4H-indol-4-one
35309-35-4 5-Oxo-3-pyrrolidinecarboxylic acid methyl ester
35310-75-9 3'-Bromo-4'-methoxyacetophenone
35319-70-1 Tiazuril
35320-23-1 (R)-2-Amino-1-propanol
35320-67-3 2-Methyl-4-indolol
35320-70-8 Tetrakis-(spirocyclohexane)-calix[4]pyrrole
35322-84-0 3,4,7-Trimethyl-2,3-dihydro-1H-indene-1-one
35323-91-2 (-)-EPICATECHIN
35325-02-1 N-(2-Hydroxypropyl)-benzenesulfonamide
35335-16-1 1,4-Bis-(bromomethyl)-2,5-dibromobenzene
35343-70-5 Coumarone Indene Resin
35344-11-7 Pentamethylcyclopentadienyl iron dicarbonyl dimer
35354-37-1 1-Bromo-5-methylhexane
35354-74-6 HONOKIOL
35354-86-0 2-(Acetoacetamido)-benzoic acid
35357-77-8 Diallylmalonic acid dimethyl ester
35365-94-7 Triethylammonium phosphate
35367-38-5 Difluron
35367-40-9 2,6-difluoro-N-[(4-fluorophenyl)carbamoyl]benzamide
35373-92-3 L-Phenylalanine-N-methylamide
35380-71-3 Estradiol hemihydrate
35386-24-4 1-(2-Methoxyphenyl)-piperazine
35387-93-0 3-Iodo-4-methoxybenzoic acid methyl ester
35392-66-6 5-Methoxy-2-methylpyridine 1-oxide
35400-43-2 O-Ethyl-O-[4-(methylthio)-phenyl]-S-propylphosphorodithioate
35400-55-6 5-Amino-4-hydroxy-2-naphthalenesulfonic acid
35401-46-8 3-Chloro-DL-alanine hydrochloride
35405-71-1 1,6-Anhydrocellobiose
35421-08-0 P-Hydroxybenzyl chloride
35424-81-8 L-Tyrosine-15N
35434-71-0 Trimethyl-d8-amine
35435-21-3 Isooctyltriethoxysilane
35436-73-8 Nα-Acetyl-DL-arginine
35439-42-0 D-Galactononitrile 2,3,4,5,6-pentaacetate
35441-52-2 Fluoromalonaldehyde
35444-44-1 Adipic acid monomethyl ester chloride
35445-70-6 ((Phenylmethoxy)methoxy)methanol
35446-36-7 S-[N-Benzyl-(thiocarbamoyl)]-L-cysteine
35449-89-9 Chloro(bis-pentafluoroethyl)phosphine
35450-36-3 2-Bromo-5-methoxybenzoic acid methyl ester
35450-37-4 3-Bromo-4-methoxybenzoic acid methyl ester
35453-19-1 5-Amino-2,4,6-triiodoisophthalic acid
35453-58-8 3-Nitro-2,4-xylenesulfonamide
35458-39-0 4-Bromo-2,5-dimethoxybenzoic acid
35466-83-2 Allyl Methyl Carbonate
35466-89-8 3,3,5/3,5,5-Trimethylhexahydroazepine
35467-65-3 P-Methylphenylhydrazine hydrochloride
35468-44-1 Bromocyclopentane-d9
35478-81-0 4-Bromo-6,8-dichloroquinoline
35480-52-5 2,5-Di (2,2,2-Trifluoroethoxy)-benzoic Acid
35482-56-5 1,4-Dihydro-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylic acid ethyl ester
35486-42-1 2-Amino-3,5-dibromopyridine
35487-17-3 Methylimidazolium chloride
35495-11-5 Z,Z-Dienestrol
35498-66-9 5β-Androstan-3-one-17β-carboxylic acid
35501-76-9 9-Ethyl-5,5'-diphenyl-3,3'-bis-(4-sulfobutyl)-benzoxazolocarbocyanine sodium salt
35507-37-0 N,N"-Sulfonylbisurea
35510-02-2 1,5-dichloro-2,4-bis(chloromethyl)benzene
35511-14-9 4-Hydroxy-2H-1,2-benzothiazine-3-carboxylic acid methyl ester 1,1-dioxide
35511-15-0 4-Hydroxy-2-methyl-2H-1,2-benzothiazine-3-carboxylic acid methyl ester 1,1-dioxide
35512-29-9 4-(4-Chlorophenyl)-1H-imidazole
35515-91-4 Vanadium telluride
35523-45-6 3-Fluoro-D-(2-2H)-alanine
35531-88-5 Carbinoxamine
35541-81-2 1,4-Bis-(hydroxymethyl)-cyclohexane dibenzoate
35543-24-9 Buflomedil Hydrochloride
35543-25-0 4-(N-Pyrrolidino)-butyronitrile
35554-08-6 Saxitoxin
35554-44-0 Metalaxyl
35558-49-7 Bromocyclohexane-d11
35558-50-0 Bromocycloheptane-d13
35561-73-0 Polyamide 6/69
35564-19-3 3,5-Bis-(trifluoromethyl)-fluorobenzene
35573-93-4 3-Chloro-1,1-diethoxypropane
35575-96-3 Azamethiphos
35577-89-0 1-[(4-Methylphenyl)-sulfonyl]-1,5,6,7-tetrahydro-4H-indol-4-one
35589-32-3 3,4-Dimethoxyaniline hydrochloride
35590-37-5 5-Bromonicotinonitrile
35597-43-4 BIALAPHOS
35604-67-2 Viloxazine hydrochloride
35607-20-6 Avridine
35607-66-0 CEFOXITIN
35608-40-6 Sodium of Polyaspartic Acid (PASP)
35619-65-9 Tritiozine
35620-71-4 2-Phenoxynicotinic acid
35620-72-5 2-(Phenylthio)-nicotinic acid
35621-01-3 4-Aminopiperidine dihydrochloride
35628-00-3 Ipsdienol
35628-05-8 Ipsenol
35629-71-1 2-Amino-4-(trifluoromethyl)-oxazole
35645-04-6 Formamide-N,N-d2
35645-49-9 2-(1H-Imidazol-1-yldiphenylmethyl)-phenol
35650-81-8 Methyleneurea
35653-54-4 1-Benzyl-3-(2-phenylethyl)-2-thiourea
35654-56-9 4-Chloro-6,7-dimethoxyquinoline
35656-93-0 Benzyl-d7-bromide
35657-77-3 Bis(hexamethylene) Triaminopenta (BHMT)
35661-39-3 Nα-9-Fluorenylmethoxycarbonyl-L-alanine
35661-40-6 FMOC-PHE-OH
35661-51-9 9-Fluorenylmethyl chloroformate hydrazine
35661-60-0 Nα-9-Fluorenylmethoxycarbonyl-L-leucine
35665-38-4 Nα-9-Fluorenylmethoxycarbonylglycyl glycine
35671-83-1 AC-MET-OME
35674-27-2 4-Iodo-3-nitrobenzoic acid
35674-68-1 Zinc 12-hydroxystearate
35675-46-8 3-Methyl-4-nitrobenzoyl chloride
35677-88-4 Benzyloxycarbonylhomoserine
35677-89-5 Benzyloxycarbonyl-L-homoserine lactone
35680-24-1 6-Chloro-5-hydroxy-α-picoline
35681-40-4 1-(2-Propyl)-2-benzimidazolidinone
35684-12-9 1-Butyl-4-[(2-(4-methoxyphenyl)-1-ethynyl]-benzene
35691-65-7 Carbendazim-thiram-bromothalonil
35692-27-4 (4-Methoxyphenyl)-trimethoxysilane
35692-88-7 Formamide-1-d1
35693-18-6 3-(4-Hydroxyphenyl)-DL-alanine-3,3-d2
35693-99-3 2,2',5,5'-Tetrachlorobiphenyl
35694-04-3 2,2',3,3',5,5'-HEXACHLOROBIPHENYL
35694-06-5 2,2',3,4,4',5-HEXACHLOROBIPHENYL
35696-77-6 1-(2,4-Dimethoxyphenyl)-2-thiourea
35696-83-4 4-Anilino-2(1H)-quinazolinethione
35699-44-6 2-Methyl-1-naphthaldehyde
35700-40-4 2,3-dihydro-benzofuran-7-carboxylic acid
35703-32-3 Cinametic acid
35710-57-7 Trizoxime
35711-41-2 1-Cyclohexyl-2,5-dimethyl-3-pyrrolecarboxaldehyde
35717-06-7 Ethyl-d5 acrylate
35723-88-7 NN-dimethylisotridecylamine
35725-34-9 Ytterbium nitrate
35725-46-3 Diphosphoric acid ferric sodium salt
35727-72-1 Ontianil
35730-09-7 2,5-difluorobenzoyl chloride
35730-27-9 1,3-Cyclopentadiene-1-carboxylic acid, methyl ester
35733-53-0 2,4-Dimethyl-5-pyrimidinamine
35737-10-1 Nα-9-Fluorenylmethoxycarbonyl-β-alanine
35737-15-6 Nalpha-FMOC-L-Tryptophan
35740-86-4 2-Bromo-3-methylquinoline
35745-35-8 Iodomethoxybenzene
35747-58-1 5-Amino-2-chlorobenzonitrile
35749-94-1 4-Chloroaniline-2,6-d2
35761-26-3 3-Amino-N-[(phenylmethoxy)-carbonyl]-L-alanine
35761-42-3 Nα-tert-Butoxycarbonyl-N-methyl-L-valine dicyclohexylamine salt
35762-76-6 4,6-Dimethylpyrimidine-2-sulfonamide
35763-44-1 Butethal sodium
35764-15-9 2-Bromo-4-(trifluoromethyl)-benzonitrile
35770-20-8 Chloro-dichloronio-platinum
35771-46-1 Sodium chloranilate
35773-42-3 3-(2-Benzoxazolyl)-7-(diethylamino)-coumarin
35777-12-9 Methyl-d3 methacrylate
35779-04-5 4-tert-Butyliodobenzene
35781-16-9 cis-2,4,5-Tris-(4-methylphenyl)-imidazoline
35785-19-4 p-Nitrobenzyl-1-thio-β-D-galactopyranoside
35785-20-7 (4-Aminophenyl)-methyl 1-thio-β-D-galactopyranoside
35788-48-8 Lead
35789-00-5 Tris(N,N-Bis(trimethylsilyl)amide)praseodymium(III)
35789-01-6 Tris(N,N-Bis(trimethylsilyl)amide)samarium(III)
35789-02-7 Tris(N,N-Bis(trimethylsilyl)amide)europium(III)
35789-04-9 Tris(N,N-Bis(trimethylsilyl)amide)lutetium(III)
35793-73-8 N-tert-Butoxycarbonyl-D-glutamic acid 5-benzyl ester
35794-11-7 3,5-dimethylpiperidine
35795-16-5 Trimazosin
35795-44-9 3-Ethyl-5-[2-(3-methyl-2-thiazolidinylidene)-ethylidene]-2-thio-2,4-oxazolidinedione
35803-56-6 Adenosine-5'-carboxylic acid methyl ester
35808-40-3 1H,2H,3H,4H-Pyrido[2,3-b]pyrazine
35811-81-5 6,7-Diacetoxy-4-oxo-4H-1-benzopyran-3-carboxaldehyde
35817-27-7 4-Ethoxycoumarin
35820-92-9 4-(Octyloxy)-benzophenone
35822-46-9 1,2,3,4,6,7,8-HEPTACHLORODIBENZO-P-DIOXIN
35822-58-3 2-Bromobenzaldehyde diethylacetal
35824-91-0 1,3-Dicyclohexylpyrimidine-2,4,6(1H,3H,5H)-trione
35825-57-1 Cryptotanshinone
35826-59-6 4-Isopropoxybenzoic acid methyl ester
35835-94-0 (Ethyl)-triphenylphosphonium acetate
35838-12-1 Tris-(2-hydroxyethyl)-1,3,5-triazine-2,4,6-trione trimethacrylate
35838-58-5 Etazolate
35842-45-6 Tiglylglycine
35845-62-6 3-Phenylpropionic-d5 acid (phenyl-d5)
35845-63-7 2-Phenyl-d5-ethanol
35845-64-8 (2-Bromoethyl)-benzene-d5
35852-46-1 (Z)-3-Hexen-1-yl valerate
35852-81-4 4-Chloro-1-methyl-1H-pyrazole
35853-41-9 2,8-Bis-(trifluoromethyl)-4-hydroxyquinoline
35853-45-3 2,8-Bis-(trifluoromethyl)-4-bromoquinoline
35853-50-0 Mefloquine carboxylic acid
35854-86-5 cis-6-Nonenol
35855-10-8 N-Morpholinoacetic acid ethyl ester
35857-89-7 6-Chloro-3-pyridazinecarbonitrile
35858-81-2 L-tryptophan benzyl ester hydrochloride
35865-33-9 Dianemycin
35869-49-9 3-Amino-2,4,6-trichlorophenol
35871-17-1 4-Chloro-2-(trichloromethyl)-quinoline
35873-49-5 8-Cyclopentyl-1,3-dimethyl-7H-purine-2,6-dione
35874-49-8 8-Aminoadenosine 5'-O-triphosphate
35877-04-4 2,6-Bis-(trifluoromethyl)-4-chloroquinoline
35878-39-8 Claussequinone
35889-69-1 Tetrahydro-N-phenyl-3-thiophenamine 1,1-dioxide
35890-38-1 N-Acetylneuraminosyl-D-lactose
35891-70-4 MYRIOCIN
35896-58-3 1,2,3,4-Tetramethoxy-5-methylbenzene
35897-25-7 N-Acetyl-S-(2,4-dinitrophenyl)-L-cysteine
35897-34-8 Boc-Arg-OH.HCl
35898-30-7 Thymidine 3',5'-dibenzoate
35898-87-4 Dilazep
35899-43-5 Nα-tert-Butoxycarbonyl-N-imidazole-(4-toluenesulfonyl)-L-histidine
35899-53-7 S-(5'-Adenosyl)-L-cysteine
35899-54-8 5'-Deoxy-5'-S-isobutyladenosine
35899-89-9 Beta-D-Galactopyranosyl azide
35902-57-9 Ethyldodecylamine
35905-85-2 2-Bromonicotinic acid
35907-89-2 Pentaamminehydroxyplatinum trichloride
35908-14-6 5-Amino-4-imidazolecarboxamide-1-β-D-ribofuranosyl-3',5'-cyclic monophosphoric acid
35909-92-3 N-Benzyloxycarbonylphenyl-L-alanine methyl ester
35913-09-8 Benzaldehyde
35920-39-9 5'-(N-Ethylcarboxamido)-adenosine
35920-98-0 cis-2,4,5-Tris-(4-chlorophenyl)-imidazoline
35923-79-6 Pentafluoroisothiocyanatobenzene
35926-76-2 2,3,10,11-Tetrahydro-2-methylspiro(5H-dibenzo(a,d)cycloheptene-5,1-(1H)isoindole)
35928-49-5 2,2-Dibromo-2'-chloro-5'-nitroacetophenone
35935-34-3 1-Ethyl-3-methylimidazolium iodine
35938-70-6 Bismuth nitrate
35941-65-2 Butriptyline
35943-35-2 Triciribine
35944-64-0 3-Iodo-p-toluidine (NH2=1)
35946-91-9 2,5-Diisopropylphenol
35947-07-0 Calcium Glycinate
35947-10-5 2-Methyl-1-(m-tolyl)-piperazine
35947-11-6 2-Methyl-1-(p-tolyl)-piperazine
35947-12-7 1-(p-Methoxyphenyl)-2-methylpiperazine
35948-25-5 9,10-Dihydro-9-Oxa-10-Phosphaphenanthrene-10-Oxide
35957-14-3 4-Hydroxy-7,8-benzo-3-quinolinecarboxylic acid
35959-60-5 2-Chloro-N-[4-(4-morpholinylsulfonyl)-phenyl]-acetamide
35963-20-3 R(-)Camphor sulfonic acid
35966-16-6 8-Chloro-4-hydroxy-3-quinolinecarboxylic acid
35966-17-7 4-Hydroxy-8-methyl-3-quinolinecarboxylic acid
35967-24-9 3,4,5-Trimethoxyphenyl isothiocyanate
35969-51-8 2-(2-Ethoxy-2-oxoethyl)-nicotinic acid
35969-54-1 2-Ethoxynicotinic acid
35969-75-6 5-Nitropicolinaldehyde
35970-79-7 4-Chloro-6-phenylthieno[2,3-d]pyrimidine
35970-80-0 (8-Phenyl-7-thia-3,5-diazabicyclo[4.3.0]nona-1,3,5,8-tetraen-2-yl)-hydrazine
35973-14-9 6-Chloro-4-hydroxy-3-quinolinecarboxylic acid
35973-17-2 8-Bromo-4-hydroxy-3-quinolinecarboxylic acid
35973-18-3 4-Hydroxy-6-methyl-3-quinolinecarboxylic acid
35973-27-4 6,8-Dichloro-4-hydroxyquinoline-3-carboxylic acid
35975-00-9 5-Amino-6-nitroquinoline
35975-57-6 8-Bromo-4-hydroxy-3-quinolinecarboxylic acid ethyl ester
35978-33-7 2-Amino-4-(4-fluorophenyl)-3-thiophenecarboxylic acid ethyl ester
35978-75-7 N-Acetyl-L-alanine 4-nitroanilide
35978-97-3 N-(ε-Aminocaproyl)-β-L-fucopyranosylamine
35984-19-1 Stannous gluconate
36001-88-4 Amiprophos-methyl
36015-19-7 2-Chloro-5-nitrocinnamic acid
36015-30-2 Propidium
36016-38-3 Tert-Butyl N-hydroxycarbamate;N-tert-Butyloxycarbonylhydroxylamine
36016-40-7 O-[(2,4,6-Trimethylphenyl)sulfonyl]-hydroxylamine
36017-19-3 4-(2-Methylphenyl)-4H-1,2,4-triazole-3-thiol
36017-21-7 4-(3-Methoxyphenyl)-4H-1,2,4-triazole-3-thiol
36023-58-2 5,6-Diamino-2,3-dicyanopyrazine
36023-64-0 5,6-Dioxo-2,3-dicyano-1,4,5,6-tetrahydropyrazine
36033-33-7 5,5-dipropylimidazolidine-2,4-dione
36042-94-1 Bis-(o-tolyl)-chlorophosphine
36049-77-1 N,N-Dicyclohexyl-N-methylcarbodiimidium iodide
36051-67-9 Inosine-5'-triphosphoric acid disodium salt
36051-82-8 6,8-Dichloro-4-hydroxycoumarin
36052-24-1 6-Aminonicotinic acid methyl ester
36052-25-2 5-Amino-3-pyridinecarboxylic acid methyl ester
36052-26-3 Methyl 6-aminopyridine-2-carboxylate
36052-27-4 3-Amino-pyridine-2-carboxylic acid methyl ester
36052-37-6 Alpinetin
36057-46-2 5-Bromo-3-methoxypicolinonitrile
36062-04-1 Tetrahydrocurcumin
36062-19-8 1,3-Diaminoguanidine Monohydrochloride
36064-19-4 Sucrose 6'-monophosphate dipotassium salt
36070-75-4 5-Chloropyrazine-2-carbonitrile
36070-80-1 5-Chloro-2-pyrazinecarboxylic acid
36075-68-0 4-Bromo-8-methylquinoline
36076-19-4 1,3-Bis-(carbomethoxy)-benzene
36076-25-2 1,4-Bis-(carbomethoxy)-benzene
36078-10-1 Lauryl oleate
36082-50-5 5-Bromo-2,4-dichloropyrimidine
36085-73-1 Talipexole Dihydrochloride
36097-42-4 N-Acetyl-3-(4-aminophenyl)-L-alanine methyl ester
36097-48-0 Acetyl-L-histidine methyl ester
36099-95-3 H-TRP-GLU-OH
36101-54-9 1,2,3,9-Tetrahydropyrrolo[2,1-b]quinazolin-9-ol
36104-80-0 Camazepam
36105-20-1 Flurazepam monohydrochloride
36117-76-7 Octachlorobiphenol
36118-45-3 Pyrazoline
36121-13-8 Burodiline
36127-17-0 2-Carbomethoxy-3-tropinone
36131-46-1 Ethyl 5-nitro-1H-pyrrole-2-carboxylate
36138-28-0 3-Chloro-5-nitrobenzoic acid methyl ester
36138-76-8 5-Bromo-2-methylphenol
36139-44-3 Anthraquinone[1,2-c]isoxazole
36140-19-9 Chlorodicyclohexylborane
36140-83-7 1-Cyanoacetyl-3,5-dimethylpyrazole
36141-82-9 Diamfenetide
36145-03-6 3,3'-Dihydroxy-2,2'-bipyridine
36148-84-2 α-Tocopheryl linoleate
36149-75-4 1-Amino-2-indolinone
36155-79-0 4-Bromo-2-propylthiophene
36155-82-5 3-Bromo-5-methyl-2-thiophenecarboxaldehyde
36157-40-1 3-Acetyl-2,5-dichlorothiophene
36157-42-3 2-Chloro-4-thiophenecarboxylic acid
36177-92-1 4-(Butylamino)-2,2,6,6-tetramethylpiperidine
36178-05-9 3-Bromo-2-fluoropyridine
36190-62-2 Zinc diisobutyldithiocarbamate
36192-63-9 2-Amino-4'-methylbenzophenone
36204-76-9 3-Aminopyrazine-2-carboxylic acid methylamide
36209-51-5 4-Amino-5-(4-pyridyl)-4H-1,2,4-triazole-3-thiol
36212-66-5 N-α-Tosyl-L-asparagine
36216-80-5 1,2-Benzisoxazol-3-amine
36219-23-5 Cyclopentanone-3,3,4,4-d4
36231-13-7 1,2,3,4,5,8-HEXAHYDRONAPHTHALENE
36239-05-5 Ethyl Malonoyl Chloride
36239-09-5 Ethanyl malonyl Chloride
36244-70-9 (S)-4-Cyano-α-methylbenzylamine
36245-95-1 2,3,4,5-Tetrachlorobenzonitrile
36256-45-8 5-(2-Bromoacetyl)-2-hydroxybenzoic acid methyl ester
36261-61-7 H-MET-ASN-OH
36265-41-5 1,4-Dihydro-2,6-dimethyl-3,5-pyridinedicarboxylic acid didodecyl ester
36267-71-7 5,7-Dihydro-2-methylthieno[3,4-d]pyrimidine
36268-67-4 4-(Methanesulfonamido)-benzonitrile
36277-32-4 (2E)-3-Morpholin-4-ylbut-2-enoic acid ethyl ester
36282-26-5 2-Bromo-4-fluorobenzonitrile
36283-44-0 (R)-(+)-n-Acetyl-1-methylbenzylamine
36284-86-3 Stearamide AMP
36289-36-8 N-Cyanoimidazole
36290-04-7 Sodium salt of polynaphthalene sulphonic acid
36292-66-7 Ethylketazocine
36305-05-2 4-Diazo-3-methoxydiphenylamine sulfate
36306-86-2 1-Ethoxy-4-(1-ethoxyethenyl)-3,3,5,5-tetramethylcyclohexene
36306-87-3 4-Ethoxyvinyl-3,3,5,5-tetramethylcyclohexanone
36309-01-0 Dimemorfan
36311-34-9 Isocetyl alcohol
36314-97-3 4-Chloro-6-phenylpyrimidin-2-amine
36315-01-2 2-Amino-4,6-dimethoxypyrimidine
36318-77-1 (1,1-Dichloro-2-methylbutan-2-yl)-benzene
36321-40-1 β-Alanine calcium salt
36321-73-0 1,2-Dibromo-3,4,5,6-tetramethylbenzene
36322-90-4 Piroxicam
36323-28-1 1,3-Bis-(dibromomethyl)-benzene
36330-85-5 Fenbufen
36335-47-4 3-Chloro-2,6-dimethoxybenzoic acid
36335-67-8 BUTAMIFOS
36340-20-2 Pentadecane-d32
36346-15-3 Diethyleneglycol/isophthalic acid/propyleneglycol/maleic anhydride copolymer
36355-01-8 Hexabromobiphenyl
36355-76-7 Adipic acid-ethyleneglycol-propyleneglycol-trimethylolpropane copolymer
36357-38-7 5-Acetyl-2-methylpyridine
36360-61-9 Nα-tert-Butoxycarbonyl-L-norleucine N-hydroxysuccinimide ester
36362-97-7 1,2,3-Benzenetricarboxylic acid hydrate
36364-49-5 Imidazole Salicylate
36365-79-4 2,3-Dihydro-2-thioxo-4-thiazoleacetic acid
36379-67-6 HERBARIN
36381-62-1 Diethyleneglycol monopalmitate
36393-20-1 L-Aspartic acid zinc salt
36393-42-7 4-(p-Tolyl)-benzaldehyde
36394-75-9 (S)-(-)-2-Acetoxypropionyl chloride
36395-07-0 N-(4-Acetoxybenzylidene)-4-butylaniline
36404-88-3 2-Chloronicotinaldehyde
36404-89-4 2-Hydroxy-pyridine-3-carbaldehyde
36404-90-7 2-Fluoronicotinaldehyde
36405-17-1 4-[(4-Butoxybenzylidene)-amino]-benzonitrile
36411-52-6 3-(N-Salicyloylamino)-1,2,4-triazole
36413-91-9 Geiparvarin
36422-95-4 N-(4-Diazo-2-methylphenyl)-pyrrolidine tetrafluoroborate
36429-14-8 2-Methylene-5-nitro-1,3,3-trimethylindoline
36431-22-8 6'-(Diethylamino)-2'-[(2,4-dimethylphenyl)-amino]-3'-methyl-spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one
36431-72-8 Theaspirane
36436-65-4 2'-Hydroxy-4',5'-dimethylacetophenone
36437-19-1 Chloromalonaldehyde
36437-37-3 2-(2H-Benzotriazol-2-yl)-6-sec-butyl-4-tert-butylphenol
36440-58-1 4-(3,5-Dimethylphenyl)-4-oxobutyric acid
36443-68-2 3-tert-Butyl-4-hydroxy-5-methylphenylpropionic acid triethyleneglycol ester
36445-71-3 Decyl-(sulfophenoxy)-benzenesulfonic acid disodium salt
36457-20-2 Sodium Butylparaben
36473-36-6 5-Iodo-3-indolyl-β-D-galactopyranoside
36480-40-7 3,4-Dichlorobenzylmercaptan
36483-57-5 Tribromo Neopentyl Alcohol
36493-25-1 Polyethyleneglycol diisostearate
36499-65-7 Ethylenediamine-N,N,N',N'-tetraacetic acid dicobalt salt
36501-84-5 Lead diamyldithiocarbamate
36505-83-6 Dectaflur
36505-84-7 Buspirone Hcl
36518-02-2 Diproqualone
36518-76-0 2-Amino-4-imino-2-thiazoline hydrochloride
36519-00-3 Bis-(2,4-dichlorophenyl)-ethyl phosphate
36520-39-5 Azetidine Hydrochloride
36521-89-8 Sorbitan distearate
36522-63-1 Syndiotactic 1,2-polybutadiene
36528-28-6 Decyl laurate
36528-80-0 3-Ethyl-2-{{3-[(1E,3E)-5-(3-ethyl-1,3-benzothiazol-2(3H)-ylidene)-1,3-pentadienyl]-5,5-dimethyl-2-cyclohexen-1-ylidene}-methyl}-1,3-benzothiazol-3-ium iodide
36530-24-2 Diammonium hexabromoiridate
36531-26-7 Oxantel
36551-21-0 Sodium sec-butylxanthate
36556-33-9 1,3,5-Trichloro-2-fluorobenzene
36556-37-3 1,3-dichloro-2,4-difluoro-benzene
36556-42-0 2,3,4-Trifluorochlorobenzene
36556-47-5 1-Bromo-2-(trifluoromethyl)-4-fluorobenzene
36556-48-6 2-Chloro-3,4-difluoroaniline
36556-50-0 2,3-Dichlorofluorobenzene
36556-51-1 2,3-Dichloro-4-fluoronitrobenzene
36556-52-2 2,3-Dichloro-4-fluoroaniline
36556-56-6 2-Chloro-4,6-difluoroaniline
36556-59-9 2-Chloro-3,5-difluoro-3-nitrobenzene
36556-60-2 2-Chloro-3,5-difluoroaniline
36557-22-9 Metomidate hydrochloride
36559-22-5 2,2',3,4'-TETRACHLOROBIPHENYL
36576-70-2 N-(4-Diazo-2-methoxyphenyl)-pyrrolidine tetrafluoroborate
36577-48-7 Zirconium carbonate
36589-29-4 L-Arginine ethyl ester dihydrochloride
36590-19-9 Amocarzine
36592-62-8 4-Acetoxy-2,3,5-trimethylphenol
36596-67-5 2,6-Dimethylbenzoic acid ethyl ester
36597-16-7 3-Amino-2-quinoxalinecarbonitrile
36598-30-8 Cyanimidodithiocarbonic acid S-benzyl ester
36600-66-5 4-tert-Butylphenylhydrazine hydrochloride
36620-11-8 Bis-(norbornadiene)-rhodium(I) tetrafluoroborate
36622-33-0 2-(3,4,5-Trimethoxyphenyl)-3-methylbutyronitrile
36624-61-0 Dibenzoyl-L-tartaric acid monodimethylamide
36625-57-7 5-Nitro-2-pyridinemethanol
36626-29-6 (2-Carboxyethyl)-triphenylphosphonium chloride
36629-42-2 Pentafluorobenzoic acid methyl ester
36631-30-8 Trimellitic acid triisodecyl ester
36635-61-7 Tosylmethyl isocyanide
36635-64-0 Tert-Butylsulfonylacetonitrile
36637-18-0 Etidocaine
36640-39-8 3-(4-Chlorophenyl)-1-phenyl-1H-pyrazole-4-methanol
36640-40-1 3-(4-Fluorophenyl)-1-phenyl-4-pyrazolecarboxaldehyde
36640-41-2 3-(4-Bromophenyl)-1-phenyl-4-pyrazolecarboxaldehyde
36640-43-4 3-(3-Chlorophenyl)-1-phenyl-1H-pyrazole-4-carboxaldehyde
36649-94-2 2,4-Bis-(trifluoromethyl)-fluorobenzene
36653-82-4 Cetyl Alcohol
36663-00-0 3-(4-Chlorophenyl)-1-phenyl-1H-pyrazole-4-carboxaldehyde
36673-16-2 Triethanolamine Titanate
36682-41-4 Sodium pentacyanoaminoferrate
36684-44-3 1,4-Butane-1,1,4,4-d4-diol
36684-45-4 1,4-Dibromobutane-1,1,4,4-d4
36687-82-8 L-Carnitine L-Tartrate
36692-49-6 3,4-Diaminobenzoic acid methyl ester
36701-01-6 α-Furfuryl pentanoate
36703-88-5 Inosine Pranobex
36711-56-5 4-[(4-Aminobenzoyl)-amino]-benzoic acid
36724-68-2 (S)-(-)-N-(Trifluoroacetyl)prolyl chloride
36725-28-7 (±)-6-(4-Aminophenyl)-5-methyl-2,3,4,5-tetrahydro-3-pyridazinone
36729-27-8 6,7,8,9-Tetrahydro-5H-carbazole-3-carboxylic acid
36734-19-7 Rovrol
36740-73-5 Flumizole
36754-60-6 2-(Chloromethyl)-benzofuran
36756-79-3 S-Benzyl-di-sec-butylthiocarbamate
36760-19-7 5-Bromo-3-chloro-1H-indazole
36761-88-3 2-Amino-4,5-diphenylthiazole hydrochloride
36763-39-0 2-Bromo-3',5'-diacetoxyacetophenone
36763-53-8 4-Oxo-2,2,6,6-tetramethylpiperidine-d16-1-oxyl
36764-94-0 2-Amino-3,5-dichlorobenzonitrile
36768-62-4 4-Amino-2,2,6,6-tetramethylpiperidine
36770-21-5 2-(1-Chloroethyl)-5-phenyl-1,3,4-oxadiazole
36776-51-9 2,3,6-Tribromo-p-cresol (OH=1)
36781-75-6 Oleyl ricinoleate
36789-14-7 Butyric-4,4,4-d3 acid
36790-28-0 N-(2-Dimethylaminoethyl)-N-ethyl-m-toluidine
36791-04-5 Ribavirin
36793-96-1 2-Methyl-5-nitro-2H-benzotriazole
36795-33-2 5-Acetohydroximoylindane
36796-46-0 1-Methyl-4-(phenylimino)-piperidine
36798-79-5 Budralazine
36798-98-8 2-Chlorophenothiazine-10-carbonyl chloride
36801-01-1 4-Mercaptobenzonitrile
36802-41-2 Bis-(2-methoxyphenyl)-phenylphosphine
36805-97-7 N,N-Dimethylformamide di-tert-butyl acetal
36809-75-3 TIN IV BUTOXIDE
36810-92-1 2-(Isothiocyanatomethyl)-thiophene
36822-09-0 4-Chlorobenzothieno[3,2-d]pyrimidine
36822-11-4 6-Phenyl-2-thiouracil
36823-84-4 4-(Pentyloxy)-benzoyl chloride
36823-88-8 P-Trifluoromethoxybenzoyl chloride
36824-73-4 3-(4-Benzyl-1-piperazinyl)-benzotrifluoride
36825-32-8 2-Amino-4-bromoquinoline
36825-34-0 3-Amino-4-bromoquinoline
36825-35-1 4-Amino-2-bromoquinoline
36825-36-2 4-Amino-3-bromoquinoline
36838-63-8 N-(3-Indolylacetyl)-L-leucine
36847-11-7 2,4,6-Tribromopyrimidine
36850-80-3 [(1-Methoxyethenyl)-oxy]-trimethylsilane
36856-91-4 2-Bromoquinoxaline
36861-47-9 3-(4-Methylbenzylidene)-DL-camphor
36863-22-6 Tetraamminehydroxyplatinum
36880-33-8 5-Ethyl-2-thiophenecarboxaldehyde
36881-42-2 1-(Bromomethyl)-4-phenoxybenzene
36885-31-1 Bis-(6,6,7,7,8,8,8-heptafluoro-2,2-dimethyl-3,5-octanedione barium salt
36886-76-7 3,6-Dimethoxyspiro(isobenzofuran-1(3H),9-(9H)xanthene)-3-one
36889-26-6 Ferric heptanoate
36894-69-6 Labetalol (base and/or unspecified salts)
36897-00-4 2,4,5-trimethoxybenzophenone
36912-83-1 1-Phenyl-2-(4-pyrimidinyl)-ethanone
36920-48-6 Cefoxazole
36923-17-8 7-Amino-3-cephem-4-carboxylic acid
36926-84-8 2-Amino-3-phenylquinoline
36930-63-9 5-(Iodoacetamidoethyl)-aminonaphthalene-1-sulfonic acid
36930-64-0 1,8-I-AEDANS
36932-40-8 1,2,3,4-Tetrahydro-3-oxo-N-phenyl-2-quinoxalineacetamide
36932-44-2 1,2,3,4-Tetrahydro-N-(4-methoxyphenyl)-3-oxo-2-quinoxalineacetamide
36936-23-9 6-Amino-3-chloro-α-picoline
36936-27-3 2-Amino-5-chloro-τ-picoline
36938-75-7 (4-Chlorophenyl)-(1-methylpiperidin-4-yl)-methanol
36940-87-1 Succinyladenosine 3',5'-cyclic monophosphate
36944-85-1 Pyridoxine-3,4'-cyclic phosphate
36944-86-2 3-(Di-2-thienylmethylene)-1.1-dimethylpiperidinium iodide
36946-70-0 2-Aminoindole hydrochloride
36947-68-9 2-Isopropylimidazole
36953-37-4 4-Bromo-2-hydroxypyridine
36953-40-9 2-Bromo-4-hydroxypyridine
36953-41-0 3-Bromo-4-hydroxypyridine
36953-42-1 3-Bromo-4-chloropyridine
36955-33-6 3-Bromo-5-(methylthio)-1,2,4-thiadiazole
36978-49-1 4-(4-Chlorobenzoyl)-butyric acid
36978-50-4 4-(2-Methylbenzoyl)-butyric acid
36978-51-5 4-(3-Methylbenzoyl)-butyric acid